![]() |
Name |
Oblongolide P
|
Molecular Formula | C14H20O3 | |
IUPAC Name* |
(3aS,5aR,7R,8R,9aS,9bR)-8-hydroxy-7,9b-dimethyl-3,3a,5a,6,7,8,9,9a-octahydrobenzo[g][2]benzofuran-1-one
|
|
SMILES |
C[C@@H]1C[C@@H]2C=C[C@@H]3COC(=O)[C@@]3([C@H]2C[C@H]1O)C
|
|
InChI |
InChI=1S/C14H20O3/c1-8-5-9-3-4-10-7-17-13(16)14(10,2)11(9)6-12(8)15/h3-4,8-12,15H,5-7H2,1-2H3/t8-,9+,10-,11+,12-,14+/m1/s1
|
|
InChIKey |
ABJNPCNYMQEGPD-TYZAEGSRSA-N
|
|
Synonyms |
Oblongolide P
|
|
CAS | NA | |
PubChem CID | 44471971 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 236.31 | ALogp: | 1.9 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 3 |
Heavy Atoms: | 17 | QED Weighted: | 0.519 |
Caco-2 Permeability: | -4.594 | MDCK Permeability: | 0.00004460 |
Pgp-inhibitor: | 0.244 | Pgp-substrate: | 0.078 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.857 |
30% Bioavailability (F30%): | 0.751 |
Blood-Brain-Barrier Penetration (BBB): | 0.93 | Plasma Protein Binding (PPB): | 74.54% |
Volume Distribution (VD): | 1.09 | Fu: | 25.39% |
CYP1A2-inhibitor: | 0.468 | CYP1A2-substrate: | 0.304 |
CYP2C19-inhibitor: | 0.043 | CYP2C19-substrate: | 0.747 |
CYP2C9-inhibitor: | 0.036 | CYP2C9-substrate: | 0.081 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.23 |
CYP3A4-inhibitor: | 0.665 | CYP3A4-substrate: | 0.343 |
Clearance (CL): | 10.285 | Half-life (T1/2): | 0.703 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.066 |
Drug-inuced Liver Injury (DILI): | 0.209 | AMES Toxicity: | 0.067 |
Rat Oral Acute Toxicity: | 0.393 | Maximum Recommended Daily Dose: | 0.09 |
Skin Sensitization: | 0.89 | Carcinogencity: | 0.201 |
Eye Corrosion: | 0.895 | Eye Irritation: | 0.984 |
Respiratory Toxicity: | 0.828 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002165 | ![]() |
1.000 | D00GOS | ![]() |
0.245 | ||
ENC002170 | ![]() |
0.541 | D03IKT | ![]() |
0.245 | ||
ENC002638 | ![]() |
0.423 | D08PIQ | ![]() |
0.237 | ||
ENC002438 | ![]() |
0.308 | D0D2TN | ![]() |
0.237 | ||
ENC000816 | ![]() |
0.296 | D0CZ1Q | ![]() |
0.237 | ||
ENC002508 | ![]() |
0.294 | D04SFH | ![]() |
0.237 | ||
ENC003132 | ![]() |
0.289 | D0Z1FX | ![]() |
0.233 | ||
ENC002215 | ![]() |
0.288 | D0F1EX | ![]() |
0.232 | ||
ENC005098 | ![]() |
0.288 | D0S3WH | ![]() |
0.226 | ||
ENC003491 | ![]() |
0.283 | D0V9DZ | ![]() |
0.224 |