|
Name |
Nodulisporol
|
| Molecular Formula | C11H14O3 | |
| IUPAC Name* |
5-methoxy-1,2,3,4-tetrahydronaphthalene-1,4-diol
|
|
| SMILES |
COC1=CC=CC2=C1C(CCC2O)O
|
|
| InChI |
InChI=1S/C11H14O3/c1-14-10-4-2-3-7-8(12)5-6-9(13)11(7)10/h2-4,8-9,12-13H,5-6H2,1H3
|
|
| InChIKey |
AHHAFDIASKKVSM-UHFFFAOYSA-N
|
|
| Synonyms |
NODULISPOROL; CHEMBL226191; BDBM50208248; (1,2,3,4-tetrahydro-5-methoxynaphthalene-1,4-diol
|
|
| CAS | NA | |
| PubChem CID | 44423670 | |
| ChEMBL ID | CHEMBL226191 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 194.23 | ALogp: | 0.7 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 49.7 | Aromatic Rings: | 2 |
| Heavy Atoms: | 14 | QED Weighted: | 0.719 |
| Caco-2 Permeability: | -4.743 | MDCK Permeability: | 0.00001480 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.713 |
| Human Intestinal Absorption (HIA): | 0.041 | 20% Bioavailability (F20%): | 0.053 |
| 30% Bioavailability (F30%): | 0.858 |
| Blood-Brain-Barrier Penetration (BBB): | 0.199 | Plasma Protein Binding (PPB): | 16.17% |
| Volume Distribution (VD): | 2.901 | Fu: | 68.31% |
| CYP1A2-inhibitor: | 0.058 | CYP1A2-substrate: | 0.928 |
| CYP2C19-inhibitor: | 0.034 | CYP2C19-substrate: | 0.89 |
| CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.861 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.863 |
| CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.567 |
| Clearance (CL): | 6.458 | Half-life (T1/2): | 0.716 |
| hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.104 |
| Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.14 |
| Rat Oral Acute Toxicity: | 0.085 | Maximum Recommended Daily Dose: | 0.851 |
| Skin Sensitization: | 0.258 | Carcinogencity: | 0.069 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.274 |
| Respiratory Toxicity: | 0.196 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005713 | ![]() |
1.000 | D05SHK | ![]() |
0.286 | ||
| ENC002458 | ![]() |
0.529 | D0E9CD | ![]() |
0.278 | ||
| ENC005721 | ![]() |
0.529 | D0T6RC | ![]() |
0.259 | ||
| ENC003969 | ![]() |
0.472 | D0W8SB | ![]() |
0.256 | ||
| ENC005842 | ![]() |
0.472 | D0Z1FX | ![]() |
0.256 | ||
| ENC005841 | ![]() |
0.472 | D0R9VR | ![]() |
0.253 | ||
| ENC004394 | ![]() |
0.472 | D0R8PX | ![]() |
0.250 | ||
| ENC004096 | ![]() |
0.442 | D08QMX | ![]() |
0.247 | ||
| ENC005719 | ![]() |
0.429 | D03DIG | ![]() |
0.244 | ||
| ENC006049 | ![]() |
0.400 | D05GKD | ![]() |
0.243 | ||