|
Name |
Pestaloficiol L
|
| Molecular Formula | C33H34O9 | |
| IUPAC Name* |
methyl 2-[2,6-dihydroxy-3-[6-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-4-yl]-4-methylbenzoyl]-3-hydroxy-5-methoxybenzoate
|
|
| SMILES |
CC1=CC(=C(C(=C1C2=CC(OC3=C(C=C(C=C23)O)CC=C(C)C)(C)C)O)C(=O)C4=C(C=C(C=C4O)OC)C(=O)OC)O
|
|
| InChI |
InChI=1S/C33H34O9/c1-16(2)8-9-18-11-19(34)12-21-23(15-33(4,5)42-31(18)21)26-17(3)10-24(35)28(29(26)37)30(38)27-22(32(39)41-7)13-20(40-6)14-25(27)36/h8,10-15,34-37H,9H2,1-7H3
|
|
| InChIKey |
OKBVEGJXRLVXHT-UHFFFAOYSA-N
|
|
| Synonyms |
Pestaloficiol L; CHEMBL1078132; methyl 2-[2,6-dihydroxy-3-[6-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-4-yl]-4-methyl-benzoyl]-3-hydroxy-5-methoxy-benzoate
|
|
| CAS | NA | |
| PubChem CID | 44254253 | |
| ChEMBL ID | CHEMBL1078132 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 574.6 | ALogp: | 6.6 |
| HBD: | 4 | HBA: | 9 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 143.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 42 | QED Weighted: | 0.151 |
| Caco-2 Permeability: | -6.087 | MDCK Permeability: | 0.00001380 |
| Pgp-inhibitor: | 0.948 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.425 | 20% Bioavailability (F20%): | 0.921 |
| 30% Bioavailability (F30%): | 0.056 |
| Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 100.11% |
| Volume Distribution (VD): | 0.294 | Fu: | 1.44% |
| CYP1A2-inhibitor: | 0.661 | CYP1A2-substrate: | 0.86 |
| CYP2C19-inhibitor: | 0.911 | CYP2C19-substrate: | 0.059 |
| CYP2C9-inhibitor: | 0.827 | CYP2C9-substrate: | 0.837 |
| CYP2D6-inhibitor: | 0.65 | CYP2D6-substrate: | 0.375 |
| CYP3A4-inhibitor: | 0.486 | CYP3A4-substrate: | 0.153 |
| Clearance (CL): | 8.841 | Half-life (T1/2): | 0.042 |
| hERG Blockers: | 0.116 | Human Hepatotoxicity (H-HT): | 0.799 |
| Drug-inuced Liver Injury (DILI): | 0.96 | AMES Toxicity: | 0.179 |
| Rat Oral Acute Toxicity: | 0.208 | Maximum Recommended Daily Dose: | 0.946 |
| Skin Sensitization: | 0.179 | Carcinogencity: | 0.049 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.027 |
| Respiratory Toxicity: | 0.262 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002375 | ![]() |
0.475 | D0Q0PR | ![]() |
0.311 | ||
| ENC004806 | ![]() |
0.440 | D0WY9N | ![]() |
0.256 | ||
| ENC005979 | ![]() |
0.429 | D0FX2Q | ![]() |
0.255 | ||
| ENC000936 | ![]() |
0.427 | D0I3XG | ![]() |
0.245 | ||
| ENC005427 | ![]() |
0.413 | D04AIT | ![]() |
0.239 | ||
| ENC002615 | ![]() |
0.410 | D0J5TS | ![]() |
0.237 | ||
| ENC005426 | ![]() |
0.409 | D0K8KX | ![]() |
0.236 | ||
| ENC005425 | ![]() |
0.406 | D07MGA | ![]() |
0.234 | ||
| ENC002109 | ![]() |
0.398 | D0AZ8C | ![]() |
0.234 | ||
| ENC002461 | ![]() |
0.398 | D04ITO | ![]() |
0.230 | ||