|
Name |
Pestaloficiol I
|
| Molecular Formula | C16H22O5 | |
| IUPAC Name* |
(6S,6aR,8S)-6-hydroxy-8-(2-hydroxypropan-2-yl)-2,2-dimethyl-5,6,6a,8-tetrahydro-3H-furo[2,3-h]chromen-4-one
|
|
| SMILES |
CC1(CC(=O)C2=C(O1)C3=C[C@H](O[C@H]3[C@H](C2)O)C(C)(C)O)C
|
|
| InChI |
InChI=1S/C16H22O5/c1-15(2)7-11(18)8-5-10(17)14-9(13(8)21-15)6-12(20-14)16(3,4)19/h6,10,12,14,17,19H,5,7H2,1-4H3/t10-,12-,14+/m0/s1
|
|
| InChIKey |
JYXSZFDEOPSZCU-VHRBIJSZSA-N
|
|
| Synonyms |
Pestaloficiol I; CHEMBL1080257; (6S,6aR,8S)-6-hydroxy-8-(1-hydroxy-1-methyl-ethyl)-2,2-dimethyl-5,6,6a,8-tetrahydro-3H-furo[2,3-h]chromen-4-one
|
|
| CAS | NA | |
| PubChem CID | 44254250 | |
| ChEMBL ID | CHEMBL1080257 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 294.34 | ALogp: | -0.4 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 76.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 21 | QED Weighted: | 0.77 |
| Caco-2 Permeability: | -4.702 | MDCK Permeability: | 0.00002660 |
| Pgp-inhibitor: | 0.151 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.955 |
| 30% Bioavailability (F30%): | 0.963 |
| Blood-Brain-Barrier Penetration (BBB): | 0.395 | Plasma Protein Binding (PPB): | 76.58% |
| Volume Distribution (VD): | 1.222 | Fu: | 21.17% |
| CYP1A2-inhibitor: | 0.054 | CYP1A2-substrate: | 0.104 |
| CYP2C19-inhibitor: | 0.16 | CYP2C19-substrate: | 0.67 |
| CYP2C9-inhibitor: | 0.14 | CYP2C9-substrate: | 0.067 |
| CYP2D6-inhibitor: | 0.051 | CYP2D6-substrate: | 0.081 |
| CYP3A4-inhibitor: | 0.068 | CYP3A4-substrate: | 0.413 |
| Clearance (CL): | 7.629 | Half-life (T1/2): | 0.557 |
| hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.323 |
| Drug-inuced Liver Injury (DILI): | 0.105 | AMES Toxicity: | 0.021 |
| Rat Oral Acute Toxicity: | 0.813 | Maximum Recommended Daily Dose: | 0.895 |
| Skin Sensitization: | 0.198 | Carcinogencity: | 0.867 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.015 |
| Respiratory Toxicity: | 0.807 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002505 | ![]() |
0.481 | D0L7AS | ![]() |
0.238 | ||
| ENC002614 | ![]() |
0.473 | D0K7LU | ![]() |
0.221 | ||
| ENC003273 | ![]() |
0.473 | D0G6AB | ![]() |
0.216 | ||
| ENC004323 | ![]() |
0.419 | D07QKN | ![]() |
0.205 | ||
| ENC002504 | ![]() |
0.410 | D0R2KF | ![]() |
0.202 | ||
| ENC002616 | ![]() |
0.392 | D02JNM | ![]() |
0.200 | ||
| ENC005845 | ![]() |
0.375 | D0P1FO | ![]() |
0.200 | ||
| ENC004338 | ![]() |
0.365 | D0G8BV | ![]() |
0.200 | ||
| ENC004147 | ![]() |
0.360 | D0CL9S | ![]() |
0.200 | ||
| ENC006129 | ![]() |
0.326 | D0Y2YP | ![]() |
0.197 | ||