NPs Basic Information
|
Name |
Lachnochromonin C
|
| Molecular Formula | C15H18O3 | |
| IUPAC Name* |
2-butan-2-yl-7-hydroxy-3,8-dimethylchromen-4-one
|
|
| SMILES |
CCC(C)C1=C(C(=O)C2=C(O1)C(=C(C=C2)O)C)C
|
|
| InChI |
InChI=1S/C15H18O3/c1-5-8(2)14-10(4)13(17)11-6-7-12(16)9(3)15(11)18-14/h6-8,16H,5H2,1-4H3
|
|
| InChIKey |
UMNRUNVNVHQRFI-UHFFFAOYSA-N
|
|
| Synonyms |
Lachnochromonin C; SCHEMBL16260699; J3.646.101B
|
|
| CAS | NA | |
| PubChem CID | 44204737 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 246.3 | ALogp: | 3.4 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 2 |
| Heavy Atoms: | 18 | QED Weighted: | 0.857 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.663 | MDCK Permeability: | 0.00002000 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.02 |
| Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.234 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.059 | Plasma Protein Binding (PPB): | 97.75% |
| Volume Distribution (VD): | 0.655 | Fu: | 2.72% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.961 | CYP1A2-substrate: | 0.959 |
| CYP2C19-inhibitor: | 0.796 | CYP2C19-substrate: | 0.561 |
| CYP2C9-inhibitor: | 0.797 | CYP2C9-substrate: | 0.812 |
| CYP2D6-inhibitor: | 0.462 | CYP2D6-substrate: | 0.577 |
| CYP3A4-inhibitor: | 0.44 | CYP3A4-substrate: | 0.521 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 4.173 | Half-life (T1/2): | 0.458 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.791 |
| Drug-inuced Liver Injury (DILI): | 0.968 | AMES Toxicity: | 0.471 |
| Rat Oral Acute Toxicity: | 0.505 | Maximum Recommended Daily Dose: | 0.61 |
| Skin Sensitization: | 0.452 | Carcinogencity: | 0.654 |
| Eye Corrosion: | 0.042 | Eye Irritation: | 0.903 |
| Respiratory Toxicity: | 0.765 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005099 |  |
0.737 | D0Z1WA |  |
0.313 | ||
| ENC005100 |  |
0.655 | D0O6KE |  |
0.308 | ||
| ENC003428 |  |
0.554 | D0FA2O |  |
0.301 | ||
| ENC005688 |  |
0.465 | D07JGT |  |
0.270 | ||
| ENC006097 |  |
0.414 | D06GIP |  |
0.262 | ||
| ENC002326 |  |
0.406 | D08HUC |  |
0.257 | ||
| ENC005802 |  |
0.391 | D0QV5T |  |
0.256 | ||
| ENC000711 |  |
0.384 | D0G5UB |  |
0.256 | ||
| ENC001953 |  |
0.380 | D0JO3U |  |
0.250 | ||
| ENC001622 |  |
0.354 | D0G4KG |  |
0.247 | ||