|
Name |
(-)-C11,C17-Epi-versicolamide B
|
| Molecular Formula | C26H29N3O4 | |
| IUPAC Name* |
(1'S,3R,7'S,9'R)-7,7,10',10'-tetramethylspiro[1H-pyrano[2,3-g]indole-3,11'-3,13-diazatetracyclo[5.5.2.01,9.03,7]tetradecane]-2,2',14'-trione
|
|
| SMILES |
CC1(C=CC2=C(O1)C=CC3=C2NC(=O)[C@@]34C[C@]56[C@@H](C4(C)C)C[C@@]7(CCCN7C5=O)C(=O)N6)C
|
|
| InChI |
InChI=1S/C26H29N3O4/c1-22(2)10-8-14-16(33-22)7-6-15-18(14)27-20(31)25(15)13-26-17(23(25,3)4)12-24(19(30)28-26)9-5-11-29(24)21(26)32/h6-8,10,17H,5,9,11-13H2,1-4H3,(H,27,31)(H,28,30)/t17-,24+,25-,26+/m1/s1
|
|
| InChIKey |
RNWRZMCJFWSZOX-KDIYZHFBSA-N
|
|
| Synonyms |
(-)-C11,C17-Epi-versicolamide B; Taichunamide E
|
|
| CAS | NA | |
| PubChem CID | 25163953 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 447.5 | ALogp: | 2.1 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 87.7 | Aromatic Rings: | 8 |
| Heavy Atoms: | 33 | QED Weighted: | 0.637 |
| Caco-2 Permeability: | -5.333 | MDCK Permeability: | 0.00002330 |
| Pgp-inhibitor: | 0.881 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.112 | 20% Bioavailability (F20%): | 0.795 |
| 30% Bioavailability (F30%): | 0.962 |
| Blood-Brain-Barrier Penetration (BBB): | 0.487 | Plasma Protein Binding (PPB): | 90.55% |
| Volume Distribution (VD): | 1.228 | Fu: | 9.43% |
| CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.776 |
| CYP2C19-inhibitor: | 0.26 | CYP2C19-substrate: | 0.923 |
| CYP2C9-inhibitor: | 0.666 | CYP2C9-substrate: | 0.816 |
| CYP2D6-inhibitor: | 0.275 | CYP2D6-substrate: | 0.15 |
| CYP3A4-inhibitor: | 0.935 | CYP3A4-substrate: | 0.932 |
| Clearance (CL): | 2.815 | Half-life (T1/2): | 0.253 |
| hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.852 |
| Drug-inuced Liver Injury (DILI): | 0.874 | AMES Toxicity: | 0.168 |
| Rat Oral Acute Toxicity: | 0.736 | Maximum Recommended Daily Dose: | 0.919 |
| Skin Sensitization: | 0.048 | Carcinogencity: | 0.953 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.168 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002366 | ![]() |
1.000 | D00ETS | ![]() |
0.221 | ||
| ENC002534 | ![]() |
1.000 | D06HBQ | ![]() |
0.219 | ||
| ENC002052 | ![]() |
0.738 | D0C7JF | ![]() |
0.213 | ||
| ENC004071 | ![]() |
0.718 | D06XZW | ![]() |
0.211 | ||
| ENC005468 | ![]() |
0.688 | D06YFA | ![]() |
0.206 | ||
| ENC004946 | ![]() |
0.687 | D08UMH | ![]() |
0.205 | ||
| ENC004943 | ![]() |
0.676 | D0D2VS | ![]() |
0.205 | ||
| ENC004072 | ![]() |
0.629 | D05AFR | ![]() |
0.204 | ||
| ENC002538 | ![]() |
0.621 | D03WAJ | ![]() |
0.203 | ||
| ENC003383 | ![]() |
0.600 | D01CKY | ![]() |
0.201 | ||