![]() |
Name |
18-oxotryprostatin A
|
Molecular Formula | C22H25N3O4 | |
IUPAC Name* |
(3S,8aS)-3-[[6-methoxy-2-(3-methylbut-2-enoyl)-1H-indol-3-yl]methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
CC(=CC(=O)C1=C(C2=C(N1)C=C(C=C2)OC)C[C@H]3C(=O)N4CCC[C@H]4C(=O)N3)C
|
|
InChI |
InChI=1S/C22H25N3O4/c1-12(2)9-19(26)20-15(14-7-6-13(29-3)10-16(14)23-20)11-17-22(28)25-8-4-5-18(25)21(27)24-17/h6-7,9-10,17-18,23H,4-5,8,11H2,1-3H3,(H,24,27)/t17-,18-/m0/s1
|
|
InChIKey |
UJAJXFUZWQQKAG-ROUUACIJSA-N
|
|
Synonyms |
18-oxotryprostatin A; CHEBI:66842; (3S,8aS)-3-{[6-methoxy-2-(3-methylbut-2-enoyl)-1H-indol-3-yl]methyl}hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; CHEMBL488641; DTXSID201105526; Q27135476; (3S,8aS)-3-[[6-methoxy-2-(3-methylbut-2-enoyl)-1H-indol-3-yl]methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; (3S,8aS)-Hexahydro-3-[[6-methoxy-2-(3-methyl-1-oxo-2-buten-1-yl)-1H-indol-3-yl]methyl]pyrrolo[1,2-a]pyrazine-1,4-dione; 1031727-30-6
|
|
CAS | 1031727-30-6 | |
PubChem CID | 24900162 | |
ChEMBL ID | CHEMBL488641 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 395.5 | ALogp: | 2.9 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 91.5 | Aromatic Rings: | 4 |
Heavy Atoms: | 29 | QED Weighted: | 0.601 |
Caco-2 Permeability: | -4.978 | MDCK Permeability: | 0.00000996 |
Pgp-inhibitor: | 0.514 | Pgp-substrate: | 0.993 |
Human Intestinal Absorption (HIA): | 0.018 | 20% Bioavailability (F20%): | 0.802 |
30% Bioavailability (F30%): | 0.006 |
Blood-Brain-Barrier Penetration (BBB): | 0.05 | Plasma Protein Binding (PPB): | 93.24% |
Volume Distribution (VD): | 0.733 | Fu: | 3.46% |
CYP1A2-inhibitor: | 0.413 | CYP1A2-substrate: | 0.915 |
CYP2C19-inhibitor: | 0.599 | CYP2C19-substrate: | 0.31 |
CYP2C9-inhibitor: | 0.808 | CYP2C9-substrate: | 0.909 |
CYP2D6-inhibitor: | 0.71 | CYP2D6-substrate: | 0.84 |
CYP3A4-inhibitor: | 0.338 | CYP3A4-substrate: | 0.542 |
Clearance (CL): | 5.646 | Half-life (T1/2): | 0.791 |
hERG Blockers: | 0.106 | Human Hepatotoxicity (H-HT): | 0.957 |
Drug-inuced Liver Injury (DILI): | 0.837 | AMES Toxicity: | 0.068 |
Rat Oral Acute Toxicity: | 0.23 | Maximum Recommended Daily Dose: | 0.922 |
Skin Sensitization: | 0.056 | Carcinogencity: | 0.63 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.947 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001941 | ![]() |
0.758 | D0J4JM | ![]() |
0.265 | ||
ENC001926 | ![]() |
0.566 | D0AN7B | ![]() |
0.265 | ||
ENC001060 | ![]() |
0.524 | D0G8NJ | ![]() |
0.263 | ||
ENC002274 | ![]() |
0.524 | D09ZIO | ![]() |
0.263 | ||
ENC004933 | ![]() |
0.510 | D0R1RS | ![]() |
0.261 | ||
ENC000981 | ![]() |
0.510 | D06HBQ | ![]() |
0.260 | ||
ENC003264 | ![]() |
0.491 | D02DPU | ![]() |
0.260 | ||
ENC001958 | ![]() |
0.491 | D0Q5NX | ![]() |
0.252 | ||
ENC003265 | ![]() |
0.478 | D03QGM | ![]() |
0.252 | ||
ENC003217 | ![]() |
0.464 | D06YFA | ![]() |
0.250 |