![]() |
Name |
Griseophenone B
|
Molecular Formula | C16H15ClO6 | |
IUPAC Name* |
(3-chloro-2,6-dihydroxy-4-methoxyphenyl)-(4-hydroxy-2-methoxy-6-methylphenyl)methanone
|
|
SMILES |
CC1=CC(=CC(=C1C(=O)C2=C(C(=C(C=C2O)OC)Cl)O)OC)O
|
|
InChI |
InChI=1S/C16H15ClO6/c1-7-4-8(18)5-10(22-2)12(7)15(20)13-9(19)6-11(23-3)14(17)16(13)21/h4-6,18-19,21H,1-3H3
|
|
InChIKey |
DSJPUSRRLBBBAS-UHFFFAOYSA-N
|
|
Synonyms |
Griseophenone B; MEGxm0_000311; CHEMBL4129112; CHEBI:81998; ZINC14647535; C18837; Q27155678; (3-chloro-2,6-dihydroxy-4-methoxyphenyl)-(4-hydroxy-2-methoxy-6-methylphenyl)methanone; NCGC00380874-01!(3-chloro-2,6-dihydroxy-4-methoxyphenyl)-(4-hydroxy-2-methoxy-6-methylphenyl)methanone
|
|
CAS | NA | |
PubChem CID | 23872096 | |
ChEMBL ID | CHEMBL4129112 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 338.74 | ALogp: | 3.7 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 23 | QED Weighted: | 0.734 |
Caco-2 Permeability: | -5.069 | MDCK Permeability: | 0.00001320 |
Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.06 | 20% Bioavailability (F20%): | 0.047 |
30% Bioavailability (F30%): | 0.076 |
Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 100.14% |
Volume Distribution (VD): | 0.4 | Fu: | 2.02% |
CYP1A2-inhibitor: | 0.933 | CYP1A2-substrate: | 0.942 |
CYP2C19-inhibitor: | 0.304 | CYP2C19-substrate: | 0.087 |
CYP2C9-inhibitor: | 0.726 | CYP2C9-substrate: | 0.859 |
CYP2D6-inhibitor: | 0.379 | CYP2D6-substrate: | 0.606 |
CYP3A4-inhibitor: | 0.528 | CYP3A4-substrate: | 0.208 |
Clearance (CL): | 12.878 | Half-life (T1/2): | 0.64 |
hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.068 |
Drug-inuced Liver Injury (DILI): | 0.945 | AMES Toxicity: | 0.186 |
Rat Oral Acute Toxicity: | 0.147 | Maximum Recommended Daily Dose: | 0.903 |
Skin Sensitization: | 0.674 | Carcinogencity: | 0.117 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.947 |
Respiratory Toxicity: | 0.593 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005938 | ![]() |
0.786 | D06GCK | ![]() |
0.368 | ||
ENC002461 | ![]() |
0.690 | D07MGA | ![]() |
0.326 | ||
ENC004226 | ![]() |
0.628 | D0C1SF | ![]() |
0.299 | ||
ENC002109 | ![]() |
0.608 | D0W7JZ | ![]() |
0.288 | ||
ENC002683 | ![]() |
0.582 | D0K8KX | ![]() |
0.274 | ||
ENC006012 | ![]() |
0.582 | D00WVW | ![]() |
0.272 | ||
ENC001395 | ![]() |
0.554 | D09DHY | ![]() |
0.270 | ||
ENC000936 | ![]() |
0.543 | D0AO5H | ![]() |
0.266 | ||
ENC002468 | ![]() |
0.542 | D04AIT | ![]() |
0.266 | ||
ENC005978 | ![]() |
0.542 | D06QKV | ![]() |
0.261 |