![]() |
Name |
Methyl 6-O-[1-methylpropyl]-beta-d-galactopyranoside
|
Molecular Formula | C11H22O6 | |
IUPAC Name* |
(2R,3R,4S,5R,6R)-2-(butan-2-yloxymethyl)-6-methoxyoxane-3,4,5-triol
|
|
SMILES |
CCC(C)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC)O)O)O
|
|
InChI |
InChI=1S/C11H22O6/c1-4-6(2)16-5-7-8(12)9(13)10(14)11(15-3)17-7/h6-14H,4-5H2,1-3H3/t6?,7-,8+,9+,10-,11-/m1/s1
|
|
InChIKey |
BCQMIVYXMQKNSE-VICZIMABSA-N
|
|
Synonyms |
Methyl 6-O-sec-butylhexopyranoside #; Methyl 6-O-[1-methylpropyl]-beta-d-galactopyranoside; Methyl 6-O-[1-methylpropyl]-.beta.-d-galactopyranoside
|
|
CAS | NA | |
PubChem CID | 22213632 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 250.29 | ALogp: | -0.7 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 88.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 17 | QED Weighted: | 0.622 |
Caco-2 Permeability: | -5.081 | MDCK Permeability: | 0.00012333 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.885 |
Human Intestinal Absorption (HIA): | 0.031 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.029 |
Blood-Brain-Barrier Penetration (BBB): | 0.21 | Plasma Protein Binding (PPB): | 21.28% |
Volume Distribution (VD): | 0.815 | Fu: | 61.20% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.465 |
CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.746 |
CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.044 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.198 |
CYP3A4-inhibitor: | 0.005 | CYP3A4-substrate: | 0.098 |
Clearance (CL): | 2.981 | Half-life (T1/2): | 0.737 |
hERG Blockers: | 0.054 | Human Hepatotoxicity (H-HT): | 0.103 |
Drug-inuced Liver Injury (DILI): | 0.099 | AMES Toxicity: | 0.569 |
Rat Oral Acute Toxicity: | 0.38 | Maximum Recommended Daily Dose: | 0.008 |
Skin Sensitization: | 0.482 | Carcinogencity: | 0.129 |
Eye Corrosion: | 0.391 | Eye Irritation: | 0.915 |
Respiratory Toxicity: | 0.496 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001062 | ![]() |
0.491 | D0H3KI | ![]() |
0.357 | ||
ENC003068 | ![]() |
0.491 | D06BQU | ![]() |
0.333 | ||
ENC000851 | ![]() |
0.443 | D07NSU | ![]() |
0.310 | ||
ENC001214 | ![]() |
0.424 | D0H2RI | ![]() |
0.310 | ||
ENC003055 | ![]() |
0.400 | D0T5BC | ![]() |
0.305 | ||
ENC000661 | ![]() |
0.357 | D05ZYM | ![]() |
0.292 | ||
ENC001625 | ![]() |
0.354 | D0R0ZL | ![]() |
0.272 | ||
ENC004548 | ![]() |
0.333 | D0Q0EX | ![]() |
0.272 | ||
ENC004291 | ![]() |
0.329 | D0I8RR | ![]() |
0.260 | ||
ENC005608 | ![]() |
0.329 | D0Z4EI | ![]() |
0.254 |