|
Name |
Agarospirol
|
| Molecular Formula | C15H26O | |
| IUPAC Name* |
2-[(3R,5R,6R)-6,10-dimethylspiro[4.5]dec-9-en-3-yl]propan-2-ol
|
|
| SMILES |
C[C@@H]1CCC=C([C@@]12CC[C@H](C2)C(C)(C)O)C
|
|
| InChI |
InChI=1S/C15H26O/c1-11-6-5-7-12(2)15(11)9-8-13(10-15)14(3,4)16/h6,12-13,16H,5,7-10H2,1-4H3/t12-,13-,15+/m1/s1
|
|
| InChIKey |
ICWHTQRTTHCUHW-NFAWXSAZSA-N
|
|
| Synonyms |
Agarospirol; 1460-73-7; 2-[(3R,5R,6R)-6,10-dimethylspiro[4.5]dec-9-en-3-yl]propan-2-ol; (-)-Agarospirol; 2-(6,10-Dimethylspiro[4.5]dec-6-en-2-yl)-2-propanol #; CHEBI:167410; alpha,alpha,6,10-Tetramethylspiro(4.5)dec-6-ene-2-methanol; Spiro(4.5)dec-6-ene-2-methanol, alpha,alpha,6,10-tetramethyl-
|
|
| CAS | 1460-73-7 | |
| PubChem CID | 21675005 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 222.37 | ALogp: | 3.7 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 2 |
| Heavy Atoms: | 16 | QED Weighted: | 0.644 |
| Caco-2 Permeability: | -4.466 | MDCK Permeability: | 0.00001830 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.049 |
| 30% Bioavailability (F30%): | 0.016 |
| Blood-Brain-Barrier Penetration (BBB): | 0.196 | Plasma Protein Binding (PPB): | 98.35% |
| Volume Distribution (VD): | 1.537 | Fu: | 2.34% |
| CYP1A2-inhibitor: | 0.14 | CYP1A2-substrate: | 0.725 |
| CYP2C19-inhibitor: | 0.285 | CYP2C19-substrate: | 0.896 |
| CYP2C9-inhibitor: | 0.324 | CYP2C9-substrate: | 0.812 |
| CYP2D6-inhibitor: | 0.031 | CYP2D6-substrate: | 0.493 |
| CYP3A4-inhibitor: | 0.177 | CYP3A4-substrate: | 0.197 |
| Clearance (CL): | 6.504 | Half-life (T1/2): | 0.243 |
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.077 |
| Drug-inuced Liver Injury (DILI): | 0.047 | AMES Toxicity: | 0.005 |
| Rat Oral Acute Toxicity: | 0.032 | Maximum Recommended Daily Dose: | 0.193 |
| Skin Sensitization: | 0.925 | Carcinogencity: | 0.102 |
| Eye Corrosion: | 0.987 | Eye Irritation: | 0.985 |
| Respiratory Toxicity: | 0.242 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003101 | ![]() |
0.712 | D07QKN | ![]() |
0.389 | ||
| ENC000860 | ![]() |
0.391 | D04SFH | ![]() |
0.220 | ||
| ENC001830 | ![]() |
0.387 | D0SC8F | ![]() |
0.212 | ||
| ENC000511 | ![]() |
0.385 | D0I2SD | ![]() |
0.207 | ||
| ENC002195 | ![]() |
0.375 | D04GJN | ![]() |
0.207 | ||
| ENC004617 | ![]() |
0.375 | D08IWD | ![]() |
0.206 | ||
| ENC002248 | ![]() |
0.375 | D02VPX | ![]() |
0.206 | ||
| ENC001013 | ![]() |
0.365 | D0B4RU | ![]() |
0.202 | ||
| ENC002138 | ![]() |
0.355 | D05BTM | ![]() |
0.202 | ||
| ENC001832 | ![]() |
0.355 | D0N1TP | ![]() |
0.202 | ||