![]() |
Name |
Epicyclonerodiol oxide
|
Molecular Formula | C15H28O3 | |
IUPAC Name* |
3-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-1,2-dimethylcyclopentan-1-ol
|
|
SMILES |
CC1C(CCC1(C)O)C2(CCC(O2)C(C)(C)O)C
|
|
InChI |
InChI=1S/C15H28O3/c1-10-11(6-8-14(10,4)17)15(5)9-7-12(18-15)13(2,3)16/h10-12,16-17H,6-9H2,1-5H3
|
|
InChIKey |
CTTSYRDQSMAGNT-UHFFFAOYSA-N
|
|
Synonyms |
Epicyclonerodiol oxide; BS-1038
|
|
CAS | NA | |
PubChem CID | 14336611 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 256.38 | ALogp: | 1.9 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.797 |
Caco-2 Permeability: | -4.492 | MDCK Permeability: | 0.00001610 |
Pgp-inhibitor: | 0.025 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.167 |
Blood-Brain-Barrier Penetration (BBB): | 0.632 | Plasma Protein Binding (PPB): | 74.77% |
Volume Distribution (VD): | 1.27 | Fu: | 25.96% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.391 |
CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.925 |
CYP2C9-inhibitor: | 0.048 | CYP2C9-substrate: | 0.152 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.411 |
CYP3A4-inhibitor: | 0.028 | CYP3A4-substrate: | 0.331 |
Clearance (CL): | 10.205 | Half-life (T1/2): | 0.384 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.183 |
Drug-inuced Liver Injury (DILI): | 0.073 | AMES Toxicity: | 0.042 |
Rat Oral Acute Toxicity: | 0.03 | Maximum Recommended Daily Dose: | 0.037 |
Skin Sensitization: | 0.07 | Carcinogencity: | 0.04 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.051 |
Respiratory Toxicity: | 0.022 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002827 | ![]() |
1.000 | D07QKN | ![]() |
0.386 | ||
ENC005088 | ![]() |
0.500 | D0N6FH | ![]() |
0.272 | ||
ENC000860 | ![]() |
0.476 | D0U3GL | ![]() |
0.271 | ||
ENC003627 | ![]() |
0.397 | D0I2SD | ![]() |
0.264 | ||
ENC002222 | ![]() |
0.385 | D0L2LS | ![]() |
0.258 | ||
ENC005066 | ![]() |
0.373 | D0S3WH | ![]() |
0.256 | ||
ENC002051 | ![]() |
0.373 | D0Z1XD | ![]() |
0.256 | ||
ENC005497 | ![]() |
0.373 | D0Q6NZ | ![]() |
0.256 | ||
ENC004067 | ![]() |
0.368 | D0Y5ZA | ![]() |
0.253 | ||
ENC004079 | ![]() |
0.368 | D03XOC | ![]() |
0.253 |