| 
                    Name | 
                         Endo-8,9-dihydrodicyclopentadiene 
                     | 
                
| Molecular Formula | C10H14 | |
| IUPAC Name* | 
                         (1S,2R,6R,7R)-tricyclo[5.2.1.02,6]dec-3-ene 
                     | 
                |
| SMILES | 
                         C1C[C@H]2C[C@@H]1[C@@H]3[C@H]2C=CC3 
                     | 
                |
| InChI | 
                         InChI=1S/C10H14/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,7-10H,3-6H2/t7-,8+,9-,10+/m0/s1 
                     | 
                |
| InChIKey | 
                         HANKSFAYJLDDKP-QCLAVDOMSA-N 
                     | 
                |
| Synonyms | 
                         Endo-8,9-dihydrodicyclopentadiene; J6JB9077LR; 8,9-Dihydrodicyclopentadiene, endo-; ZINC98177029; Q27281274; 4,7-Methano-1H-indene, 3a,4,5,6,7,7a-hexahydro-, (3aR,4S,7R,7aR)-rel-; 4,7-METHANO-1H-INDENE, 3A,4,5,6,7,7A-HEXAHYDRO-, (3A.ALPHA.,4.ALPHA.,7.ALPHA.,7A.ALPHA.)- 
                     | 
                |
| CAS | NA | |
| PubChem CID | 12592100 | |
| ChEMBL ID | NA | 
Chemical Classification: | 
                    
                        
  | 
                    
                        
                            
                     | 
                
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | 
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | 
| Molecular Weight: | 134.22 | ALogp: | 3.1 | 
| HBD: | 0 | HBA: | 0 | 
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted | 
| Polar Surface Area: | 0.0 | Aromatic Rings: | 3 | 
| Heavy Atoms: | 10 | QED Weighted: | 0.445 | 
| Caco-2 Permeability: | -4.463 | MDCK Permeability: | 0.00003540 | 
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.026 | 
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.029 | 
| 30% Bioavailability (F30%): | 0.019 | 
| Blood-Brain-Barrier Penetration (BBB): | 0.389 | Plasma Protein Binding (PPB): | 93.44% | 
| Volume Distribution (VD): | 2.657 | Fu: | 7.55% | 
| CYP1A2-inhibitor: | 0.947 | CYP1A2-substrate: | 0.836 | 
| CYP2C19-inhibitor: | 0.483 | CYP2C19-substrate: | 0.83 | 
| CYP2C9-inhibitor: | 0.133 | CYP2C9-substrate: | 0.657 | 
| CYP2D6-inhibitor: | 0.024 | CYP2D6-substrate: | 0.745 | 
| CYP3A4-inhibitor: | 0.393 | CYP3A4-substrate: | 0.275 | 
| Clearance (CL): | 14.087 | Half-life (T1/2): | 0.638 | 
| hERG Blockers: | 0.041 | Human Hepatotoxicity (H-HT): | 0.19 | 
| Drug-inuced Liver Injury (DILI): | 0.84 | AMES Toxicity: | 0.185 | 
| Rat Oral Acute Toxicity: | 0.106 | Maximum Recommended Daily Dose: | 0.078 | 
| Skin Sensitization: | 0.942 | Carcinogencity: | 0.472 | 
| Eye Corrosion: | 0.989 | Eye Irritation: | 0.99 | 
| Respiratory Toxicity: | 0.385 | 
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001169 | ![]()  | 
                    0.267 | D0L0MK | ![]()  | 
                    0.209 | ||
| ENC000828 | ![]()  | 
                    0.245 | D04URO | ![]()  | 
                    0.207 | ||
| ENC002860 | ![]()  | 
                    0.239 | D06OSM | ![]()  | 
                    0.191 | ||
| ENC002040 | ![]()  | 
                    0.222 | D0Z1FX | ![]()  | 
                    0.187 | ||
| ENC001298 | ![]()  | 
                    0.222 | D04CSZ | ![]()  | 
                    0.180 | ||
| ENC003771 | ![]()  | 
                    0.217 | D0H4JM | ![]()  | 
                    0.180 | ||
| ENC003074 | ![]()  | 
                    0.217 | D08QMX | ![]()  | 
                    0.176 | ||
| ENC001414 | ![]()  | 
                    0.212 | D0F1UL | ![]()  | 
                    0.175 | ||
| ENC002215 | ![]()  | 
                    0.211 | D0K0EK | ![]()  | 
                    0.171 | ||
| ENC003784 | ![]()  | 
                    0.211 | D0R7WU | ![]()  | 
                    0.164 | ||