![]() |
Name |
1,4-Dihydroxy-3-methoxy-6-methylanthraquinone
|
Molecular Formula | C16H12O5 | |
IUPAC Name* |
1,4-dihydroxy-2-methoxy-7-methylanthracene-9,10-dione
|
|
SMILES |
CC1=CC2=C(C=C1)C(=O)C3=C(C2=O)C(=C(C=C3O)OC)O
|
|
InChI |
InChI=1S/C16H12O5/c1-7-3-4-8-9(5-7)15(19)13-12(14(8)18)10(17)6-11(21-2)16(13)20/h3-6,17,20H,1-2H3
|
|
InChIKey |
IVJVOKCJFGMBTB-UHFFFAOYSA-N
|
|
Synonyms |
1,4-Dihydroxy-3-methoxy-6-methylanthraquinone; 1,4-dihydroxy-2-methoxy-7-methylanthracene-9,10-dione; CHEMBL1224808; SCHEMBL23199031; 1,4-dihydroxy-2-methoxy-7-methylanthraquinone
|
|
CAS | NA | |
PubChem CID | 12416403 | |
ChEMBL ID | CHEMBL1224808 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 284.26 | ALogp: | 3.6 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.671 |
Caco-2 Permeability: | -4.985 | MDCK Permeability: | 0.00001850 |
Pgp-inhibitor: | 0.026 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.022 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.724 |
Blood-Brain-Barrier Penetration (BBB): | 0.017 | Plasma Protein Binding (PPB): | 99.33% |
Volume Distribution (VD): | 0.374 | Fu: | 1.68% |
CYP1A2-inhibitor: | 0.969 | CYP1A2-substrate: | 0.826 |
CYP2C19-inhibitor: | 0.572 | CYP2C19-substrate: | 0.139 |
CYP2C9-inhibitor: | 0.77 | CYP2C9-substrate: | 0.518 |
CYP2D6-inhibitor: | 0.681 | CYP2D6-substrate: | 0.299 |
CYP3A4-inhibitor: | 0.577 | CYP3A4-substrate: | 0.142 |
Clearance (CL): | 6.46 | Half-life (T1/2): | 0.278 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.693 |
Drug-inuced Liver Injury (DILI): | 0.943 | AMES Toxicity: | 0.86 |
Rat Oral Acute Toxicity: | 0.727 | Maximum Recommended Daily Dose: | 0.922 |
Skin Sensitization: | 0.817 | Carcinogencity: | 0.893 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.799 |
Respiratory Toxicity: | 0.49 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000706 | ![]() |
0.727 | D07MGA | ![]() |
0.356 | ||
ENC002125 | ![]() |
0.652 | D06GCK | ![]() |
0.355 | ||
ENC002031 | ![]() |
0.583 | D0N1FS | ![]() |
0.327 | ||
ENC000939 | ![]() |
0.583 | D01XDL | ![]() |
0.325 | ||
ENC002766 | ![]() |
0.568 | D01XWG | ![]() |
0.311 | ||
ENC005490 | ![]() |
0.566 | D0Y7PG | ![]() |
0.306 | ||
ENC003447 | ![]() |
0.562 | D0C9XJ | ![]() |
0.304 | ||
ENC002107 | ![]() |
0.547 | D07VLY | ![]() |
0.304 | ||
ENC000362 | ![]() |
0.541 | D03GET | ![]() |
0.292 | ||
ENC005551 | ![]() |
0.534 | D0K8KX | ![]() |
0.286 |