|
Name |
aigialomycin D
|
| Molecular Formula | C18H22O6 | |
| IUPAC Name* |
(4S,6E,8R,9S,12E)-8,9,16,18-tetrahydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one
|
|
| SMILES |
C[C@H]1C/C=C/[C@H]([C@H](CC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1)O)O
|
|
| InChI |
InChI=1S/C18H22O6/c1-11-5-4-8-15(21)14(20)7-3-2-6-12-9-13(19)10-16(22)17(12)18(23)24-11/h2,4,6,8-11,14-15,19-22H,3,5,7H2,1H3/b6-2+,8-4+/t11-,14-,15+/m0/s1
|
|
| InChIKey |
NHAQNKDEUQPSIX-DXOCLGOBSA-N
|
|
| Synonyms |
aigialomycin D; CHEMBL1173442; SCHEMBL669023; (4S,6E,8R,9S,12E)-8,9,16,18-tetrahydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-2-one
|
|
| CAS | NA | |
| PubChem CID | 11724428 | |
| ChEMBL ID | CHEMBL1173442 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 334.4 | ALogp: | 2.9 |
| HBD: | 4 | HBA: | 6 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 107.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 24 | QED Weighted: | 0.429 |
| Caco-2 Permeability: | -5.046 | MDCK Permeability: | 0.00001830 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.068 | 20% Bioavailability (F20%): | 0.775 |
| 30% Bioavailability (F30%): | 0.997 |
| Blood-Brain-Barrier Penetration (BBB): | 0.275 | Plasma Protein Binding (PPB): | 98.07% |
| Volume Distribution (VD): | 1.002 | Fu: | 2.97% |
| CYP1A2-inhibitor: | 0.463 | CYP1A2-substrate: | 0.075 |
| CYP2C19-inhibitor: | 0.042 | CYP2C19-substrate: | 0.058 |
| CYP2C9-inhibitor: | 0.043 | CYP2C9-substrate: | 0.951 |
| CYP2D6-inhibitor: | 0.801 | CYP2D6-substrate: | 0.277 |
| CYP3A4-inhibitor: | 0.375 | CYP3A4-substrate: | 0.06 |
| Clearance (CL): | 8.47 | Half-life (T1/2): | 0.88 |
| hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.152 |
| Drug-inuced Liver Injury (DILI): | 0.093 | AMES Toxicity: | 0.009 |
| Rat Oral Acute Toxicity: | 0.021 | Maximum Recommended Daily Dose: | 0.952 |
| Skin Sensitization: | 0.71 | Carcinogencity: | 0.735 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.15 |
| Respiratory Toxicity: | 0.674 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001570 | ![]() |
0.529 | D07MGA | ![]() |
0.309 | ||
| ENC002425 | ![]() |
0.453 | D04AIT | ![]() |
0.265 | ||
| ENC004730 | ![]() |
0.435 | D0AZ8C | ![]() |
0.262 | ||
| ENC002701 | ![]() |
0.425 | D0K8KX | ![]() |
0.248 | ||
| ENC003140 | ![]() |
0.425 | D0WE3O | ![]() |
0.235 | ||
| ENC005419 | ![]() |
0.425 | D0Z1FX | ![]() |
0.225 | ||
| ENC002286 | ![]() |
0.425 | D0I9HF | ![]() |
0.219 | ||
| ENC002287 | ![]() |
0.425 | D0R6BI | ![]() |
0.214 | ||
| ENC003870 | ![]() |
0.425 | D04JHN | ![]() |
0.212 | ||
| ENC005643 | ![]() |
0.425 | D0KN2M | ![]() |
0.210 | ||