|
Name |
Cytochalasin Z9
|
| Molecular Formula | C28H35NO5 | |
| IUPAC Name* |
(1S,4E,6S,8S,10E,12S,13S,16S,17S)-17-benzyl-6,13-dihydroxy-6,8,14,15-tetramethyl-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,14-triene-3,19-dione
|
|
| SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H](C(=C([C@@H]3[C@]2(C(=O)N[C@H]3CC4=CC=CC=C4)OC(=O)/C=C/[C@@](C1)(C)O)C)C)O
|
|
| InChI |
InChI=1S/C28H35NO5/c1-17-9-8-12-21-25(31)19(3)18(2)24-22(15-20-10-6-5-7-11-20)29-26(32)28(21,24)34-23(30)13-14-27(4,33)16-17/h5-8,10-14,17,21-22,24-25,31,33H,9,15-16H2,1-4H3,(H,29,32)/b12-8+,14-13+/t17-,21-,22-,24-,25+,27+,28+/m0/s1
|
|
| InChIKey |
FMVOQLPSYHHBLW-GTCNGBCISA-N
|
|
| Synonyms |
Cytochalasin Z9; CHEMBL498455; (1S,4E,6S,8S,10E,12S,13S,16S,17S)-17-benzyl-6,13-dihydroxy-6,8,14,15-tetramethyl-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,14-triene-3,19-dione; 896133-08-7
|
|
| CAS | NA | |
| PubChem CID | 11648385 | |
| ChEMBL ID | CHEMBL498455 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 465.6 | ALogp: | 2.7 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 95.9 | Aromatic Rings: | 4 |
| Heavy Atoms: | 34 | QED Weighted: | 0.453 |
| Caco-2 Permeability: | -5.101 | MDCK Permeability: | 0.00007210 |
| Pgp-inhibitor: | 0.036 | Pgp-substrate: | 0.993 |
| Human Intestinal Absorption (HIA): | 0.029 | 20% Bioavailability (F20%): | 0.01 |
| 30% Bioavailability (F30%): | 0.625 |
| Blood-Brain-Barrier Penetration (BBB): | 0.924 | Plasma Protein Binding (PPB): | 93.27% |
| Volume Distribution (VD): | 0.768 | Fu: | 6.54% |
| CYP1A2-inhibitor: | 0.068 | CYP1A2-substrate: | 0.14 |
| CYP2C19-inhibitor: | 0.832 | CYP2C19-substrate: | 0.707 |
| CYP2C9-inhibitor: | 0.647 | CYP2C9-substrate: | 0.084 |
| CYP2D6-inhibitor: | 0.347 | CYP2D6-substrate: | 0.057 |
| CYP3A4-inhibitor: | 0.952 | CYP3A4-substrate: | 0.312 |
| Clearance (CL): | 10.064 | Half-life (T1/2): | 0.02 |
| hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.294 |
| Drug-inuced Liver Injury (DILI): | 0.235 | AMES Toxicity: | 0.073 |
| Rat Oral Acute Toxicity: | 0.896 | Maximum Recommended Daily Dose: | 0.957 |
| Skin Sensitization: | 0.592 | Carcinogencity: | 0.47 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.015 |
| Respiratory Toxicity: | 0.981 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002161 | ![]() |
0.741 | D0V3ZA | ![]() |
0.284 | ||
| ENC003169 | ![]() |
0.729 | D0SP3D | ![]() |
0.282 | ||
| ENC002763 | ![]() |
0.693 | D06CWH | ![]() |
0.278 | ||
| ENC004801 | ![]() |
0.664 | D01TSI | ![]() |
0.276 | ||
| ENC005134 | ![]() |
0.649 | D09NNH | ![]() |
0.276 | ||
| ENC005761 | ![]() |
0.637 | D0D7KC | ![]() |
0.248 | ||
| ENC004368 | ![]() |
0.605 | D0W7RJ | ![]() |
0.246 | ||
| ENC005130 | ![]() |
0.605 | D0I0DL | ![]() |
0.244 | ||
| ENC004463 | ![]() |
0.598 | D0Z9NZ | ![]() |
0.241 | ||
| ENC005129 | ![]() |
0.591 | D0IN7I | ![]() |
0.241 | ||