|
Name |
(-)-Altenuene
|
| Molecular Formula | C15H16O6 | |
| IUPAC Name* |
(2R,3R,4aR)-2,3,7-trihydroxy-9-methoxy-4a-methyl-3,4-dihydro-2H-benzo[c]chromen-6-one
|
|
| SMILES |
C[C@@]12C[C@H]([C@@H](C=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O)O
|
|
| InChI |
InChI=1S/C15H16O6/c1-15-6-12(18)10(16)5-9(15)8-3-7(20-2)4-11(17)13(8)14(19)21-15/h3-5,10,12,16-18H,6H2,1-2H3/t10-,12-,15-/m1/s1
|
|
| InChIKey |
MMHTXEATDNFMMY-IXPVHAAZSA-N
|
|
| Synonyms |
(-)-Altenuene; 889101-41-1; (2R,3R,4aR)-2,3,7-trihydroxy-9-methoxy-4a-methyl-3,4-dihydro-2H-benzo[c]chromen-6-one; (2R,3R,4aR)-2,3,4,4a-Tetrahydro-2,3,7-trihydroxy-9-methoxy-4a-methyl-6H-dibenzo[b,d]pyran-6-one; (2R,3R,4aR)-2,3,7-trihydroxy-9-methoxy-4a-methyl-2H,3H,4H,4aH,6H-benzo[c]chromen-6-one; (+/-)-Altenuene; CHEBI:144317; ZINC13312093; BA162707; (+/-)-Altenuene 10 microg/mL in Acetonitrile; (2R,3R,4aR)-2,3,7-trihydroxy-9-methoxy-4a-methyl-2,3,4,4a-tetrahydro-6H-benzo[c]chromen-6-one; (2R,3R,4aR)-2,3,7-trihydroxy-9-methoxy-4a-methyl-2,3,4,4a-tetrahydro-6H-dibenzo[b,d]pyran-6-one; 2,3,4,4a-Tetrahydro-2beta,3alpha,7-trihydroxy-9-methoxy-4aalpha-methyl-6H-dibenzo[b,d]pyran-6-one
|
|
| CAS | 29752-43-0 | |
| PubChem CID | 11645000 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 292.28 | ALogp: | 0.7 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 96.2 | Aromatic Rings: | 3 |
| Heavy Atoms: | 21 | QED Weighted: | 0.674 |
| Caco-2 Permeability: | -4.809 | MDCK Permeability: | 0.00000657 |
| Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.363 |
| Human Intestinal Absorption (HIA): | 0.089 | 20% Bioavailability (F20%): | 0.017 |
| 30% Bioavailability (F30%): | 0.367 |
| Blood-Brain-Barrier Penetration (BBB): | 0.629 | Plasma Protein Binding (PPB): | 72.09% |
| Volume Distribution (VD): | 0.341 | Fu: | 32.26% |
| CYP1A2-inhibitor: | 0.032 | CYP1A2-substrate: | 0.537 |
| CYP2C19-inhibitor: | 0.08 | CYP2C19-substrate: | 0.845 |
| CYP2C9-inhibitor: | 0.065 | CYP2C9-substrate: | 0.734 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.35 |
| CYP3A4-inhibitor: | 0.048 | CYP3A4-substrate: | 0.351 |
| Clearance (CL): | 5.386 | Half-life (T1/2): | 0.76 |
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.12 |
| Drug-inuced Liver Injury (DILI): | 0.288 | AMES Toxicity: | 0.358 |
| Rat Oral Acute Toxicity: | 0.561 | Maximum Recommended Daily Dose: | 0.935 |
| Skin Sensitization: | 0.291 | Carcinogencity: | 0.06 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.355 |
| Respiratory Toxicity: | 0.626 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000971 | ![]() |
1.000 | D07MGA | ![]() |
0.297 | ||
| ENC004851 | ![]() |
1.000 | D0J4IX | ![]() |
0.240 | ||
| ENC004819 | ![]() |
1.000 | D0P1FO | ![]() |
0.235 | ||
| ENC006131 | ![]() |
1.000 | D0I9HF | ![]() |
0.232 | ||
| ENC006132 | ![]() |
1.000 | D04UTT | ![]() |
0.227 | ||
| ENC006071 | ![]() |
0.773 | D06GCK | ![]() |
0.223 | ||
| ENC003769 | ![]() |
0.718 | D01XWG | ![]() |
0.221 | ||
| ENC003974 | ![]() |
0.718 | D0AZ8C | ![]() |
0.220 | ||
| ENC003686 | ![]() |
0.718 | D0C1SF | ![]() |
0.220 | ||
| ENC004850 | ![]() |
0.718 | D08CCE | ![]() |
0.219 | ||