![]() |
Name |
Quinolactacide
|
Molecular Formula | C14H8N2O2 | |
IUPAC Name* |
9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7,11,13-hexaene-2,16-dione
|
|
SMILES |
C1=CC=C2C(=C1)C(=O)C3=C(N2)C4=CC=CN4C3=O
|
|
InChI |
InChI=1S/C14H8N2O2/c17-13-8-4-1-2-5-9(8)15-12-10-6-3-7-16(10)14(18)11(12)13/h1-7H,(H,15,17)
|
|
InChIKey |
QFTHRUCJNWMSRD-UHFFFAOYSA-N
|
|
Synonyms |
QUINOLACTACIDE; 856216-29-0; CHEMBL2269361; DTXSID60467291
|
|
CAS | 856216-29-0 | |
PubChem CID | 11481760 | |
ChEMBL ID | CHEMBL2269361 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 236.22 | ALogp: | 1.8 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 51.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 18 | QED Weighted: | 0.51 |
Caco-2 Permeability: | -4.937 | MDCK Permeability: | 0.00001570 |
Pgp-inhibitor: | 0.02 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.772 | Plasma Protein Binding (PPB): | 78.82% |
Volume Distribution (VD): | 0.899 | Fu: | 6.68% |
CYP1A2-inhibitor: | 0.972 | CYP1A2-substrate: | 0.585 |
CYP2C19-inhibitor: | 0.454 | CYP2C19-substrate: | 0.177 |
CYP2C9-inhibitor: | 0.437 | CYP2C9-substrate: | 0.861 |
CYP2D6-inhibitor: | 0.141 | CYP2D6-substrate: | 0.299 |
CYP3A4-inhibitor: | 0.298 | CYP3A4-substrate: | 0.293 |
Clearance (CL): | 1.589 | Half-life (T1/2): | 0.462 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.528 |
Drug-inuced Liver Injury (DILI): | 0.977 | AMES Toxicity: | 0.237 |
Rat Oral Acute Toxicity: | 0.092 | Maximum Recommended Daily Dose: | 0.756 |
Skin Sensitization: | 0.22 | Carcinogencity: | 0.614 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.095 |
Respiratory Toxicity: | 0.948 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002699 | ![]() |
0.493 | D05MQK | ![]() |
0.320 | ||
ENC004683 | ![]() |
0.473 | D0B1FE | ![]() |
0.320 | ||
ENC004694 | ![]() |
0.465 | D02WCI | ![]() |
0.314 | ||
ENC002980 | ![]() |
0.465 | D08FTG | ![]() |
0.312 | ||
ENC004695 | ![]() |
0.465 | D08VRO | ![]() |
0.311 | ||
ENC004690 | ![]() |
0.452 | D0W7WC | ![]() |
0.300 | ||
ENC004689 | ![]() |
0.452 | D02TJS | ![]() |
0.295 | ||
ENC004692 | ![]() |
0.434 | D03GET | ![]() |
0.294 | ||
ENC004687 | ![]() |
0.434 | D09WKB | ![]() |
0.293 | ||
ENC000858 | ![]() |
0.432 | D0QL3P | ![]() |
0.293 |