|
Name |
(+)-Thujopsene
|
| Molecular Formula | C15H24 | |
| IUPAC Name* |
(1aR,4aR,8aR)-2,4a,8,8-tetramethyl-1,1a,4,5,6,7-hexahydrocyclopropa[j]naphthalene
|
|
| SMILES |
CC1=CC[C@]2(CCCC([C@@]23[C@@H]1C3)(C)C)C
|
|
| InChI |
InChI=1S/C15H24/c1-11-6-9-14(4)8-5-7-13(2,3)15(14)10-12(11)15/h6,12H,5,7-10H2,1-4H3/t12-,14-,15-/m1/s1
|
|
| InChIKey |
WXQGPFZDVCRBME-BPLDGKMQSA-N
|
|
| Synonyms |
(+)-thujopsene; cis-Thujopsene; 470-40-6; (1aR,4aR,8aR)-2,4a,8,8-tetramethyl-1,1a,4,4a,5,6,7,8-octahydrocyclopropa[d]naphthalene; (-)-Thujopsen; CHEBI:61737; DTXSID50881245; ZINC62234905; C20724; Q27131354; (1aR,4aR,81R)-2,4a,8,8-tetramethyl-1,1a,4,4a,5,6,7,8-octahydrocyclopropa[d]naphthalene
|
|
| CAS | 470-40-6 | |
| PubChem CID | 11401461 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 204.35 | ALogp: | 4.8 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 15 | QED Weighted: | 0.485 |
| Caco-2 Permeability: | -4.535 | MDCK Permeability: | 0.00001130 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.867 |
| 30% Bioavailability (F30%): | 0.771 |
| Blood-Brain-Barrier Penetration (BBB): | 0.165 | Plasma Protein Binding (PPB): | 97.03% |
| Volume Distribution (VD): | 2.353 | Fu: | 3.85% |
| CYP1A2-inhibitor: | 0.353 | CYP1A2-substrate: | 0.734 |
| CYP2C19-inhibitor: | 0.575 | CYP2C19-substrate: | 0.917 |
| CYP2C9-inhibitor: | 0.474 | CYP2C9-substrate: | 0.816 |
| CYP2D6-inhibitor: | 0.095 | CYP2D6-substrate: | 0.874 |
| CYP3A4-inhibitor: | 0.532 | CYP3A4-substrate: | 0.248 |
| Clearance (CL): | 7.986 | Half-life (T1/2): | 0.13 |
| hERG Blockers: | 0.023 | Human Hepatotoxicity (H-HT): | 0.089 |
| Drug-inuced Liver Injury (DILI): | 0.031 | AMES Toxicity: | 0.016 |
| Rat Oral Acute Toxicity: | 0.051 | Maximum Recommended Daily Dose: | 0.045 |
| Skin Sensitization: | 0.849 | Carcinogencity: | 0.109 |
| Eye Corrosion: | 0.977 | Eye Irritation: | 0.936 |
| Respiratory Toxicity: | 0.502 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001080 | ![]() |
1.000 | D0H1QY | ![]() |
0.250 | ||
| ENC002262 | ![]() |
0.500 | D0L2LS | ![]() |
0.233 | ||
| ENC003100 | ![]() |
0.474 | D0A2AJ | ![]() |
0.230 | ||
| ENC001322 | ![]() |
0.424 | D0Z1XD | ![]() |
0.229 | ||
| ENC002074 | ![]() |
0.393 | D04GJN | ![]() |
0.225 | ||
| ENC001831 | ![]() |
0.390 | D01CKY | ![]() |
0.222 | ||
| ENC002112 | ![]() |
0.390 | D01JEU | ![]() |
0.222 | ||
| ENC003051 | ![]() |
0.367 | D0V8HA | ![]() |
0.217 | ||
| ENC000588 | ![]() |
0.367 | D0U3GL | ![]() |
0.214 | ||
| ENC001077 | ![]() |
0.355 | D0I2SD | ![]() |
0.211 | ||