|
Name |
(-)-Rasfonin
|
| Molecular Formula | C25H38O6 | |
| IUPAC Name* |
[(2R,3R)-2-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoate
|
|
| SMILES |
C/C=C(\C)/C[C@H](C)C[C@H](C)[C@@H]1[C@@H](C=CC(=O)O1)OC(=O)/C=C/C(=C/[C@H](CCO)CO)/C
|
|
| InChI |
InChI=1S/C25H38O6/c1-6-17(2)13-19(4)14-20(5)25-22(8-10-24(29)31-25)30-23(28)9-7-18(3)15-21(16-27)11-12-26/h6-10,15,19-22,25-27H,11-14,16H2,1-5H3/b9-7+,17-6+,18-15+/t19-,20-,21-,22+,25+/m0/s1
|
|
| InChIKey |
OHRGHFXATDKGOV-FXYCKZMJSA-N
|
|
| Synonyms |
(-)-Rasfonin; Rasfonin; 303156-68-5; (2E,4E,6S)-8-hydroxy-6-(hydroxymethyl)-4-methyl-2,4-octadienoic acid, (2R,3R)-3,6-dihydro-6-oxo-2-[(1S,3R,5E)-1,3,5-trimethyl-5-hepten-1-yl]-2H-pyran-3-yl ester; (a?-Rasfonin; DTXSID301043830; ZINC35465241; HY-121532; CS-0082478; [(2R,3R)-2-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoate
|
|
| CAS | 303156-68-5 | |
| PubChem CID | 11259090 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 434.6 | ALogp: | 4.9 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 13 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 93.1 | Aromatic Rings: | 1 |
| Heavy Atoms: | 31 | QED Weighted: | 0.203 |
| Caco-2 Permeability: | -4.748 | MDCK Permeability: | 0.00002770 |
| Pgp-inhibitor: | 0.954 | Pgp-substrate: | 0.011 |
| Human Intestinal Absorption (HIA): | 0.942 | 20% Bioavailability (F20%): | 0.968 |
| 30% Bioavailability (F30%): | 0.975 |
| Blood-Brain-Barrier Penetration (BBB): | 0.944 | Plasma Protein Binding (PPB): | 94.46% |
| Volume Distribution (VD): | 1.588 | Fu: | 3.67% |
| CYP1A2-inhibitor: | 0.07 | CYP1A2-substrate: | 0.087 |
| CYP2C19-inhibitor: | 0.259 | CYP2C19-substrate: | 0.448 |
| CYP2C9-inhibitor: | 0.822 | CYP2C9-substrate: | 0.075 |
| CYP2D6-inhibitor: | 0.087 | CYP2D6-substrate: | 0.074 |
| CYP3A4-inhibitor: | 0.91 | CYP3A4-substrate: | 0.344 |
| Clearance (CL): | 10.508 | Half-life (T1/2): | 0.877 |
| hERG Blockers: | 0.073 | Human Hepatotoxicity (H-HT): | 0.937 |
| Drug-inuced Liver Injury (DILI): | 0.019 | AMES Toxicity: | 0.007 |
| Rat Oral Acute Toxicity: | 0.087 | Maximum Recommended Daily Dose: | 0.983 |
| Skin Sensitization: | 0.971 | Carcinogencity: | 0.051 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.022 |
| Respiratory Toxicity: | 0.891 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005693 | ![]() |
0.392 | D02RQU | ![]() |
0.231 | ||
| ENC005692 | ![]() |
0.381 | D0N3NO | ![]() |
0.215 | ||
| ENC006085 | ![]() |
0.351 | D0ZI4H | ![]() |
0.207 | ||
| ENC001864 | ![]() |
0.346 | D03JSJ | ![]() |
0.192 | ||
| ENC001863 | ![]() |
0.346 | D05XQE | ![]() |
0.190 | ||
| ENC001858 | ![]() |
0.315 | D06WTZ | ![]() |
0.188 | ||
| ENC003191 | ![]() |
0.308 | D0E9KA | ![]() |
0.186 | ||
| ENC005574 | ![]() |
0.301 | D0B1IP | ![]() |
0.185 | ||
| ENC005670 | ![]() |
0.286 | D05QDC | ![]() |
0.184 | ||
| ENC003253 | ![]() |
0.274 | D0HD9K | ![]() |
0.183 | ||