![]() |
Name |
Alboatrin
|
Molecular Formula | C14H18O3 | |
IUPAC Name* |
(3S,3aR,9aR)-3,5,9a-trimethyl-2,3,3a,4-tetrahydrofuro[2,3-b]chromen-7-ol
|
|
SMILES |
C[C@@H]1CO[C@]2([C@@H]1CC3=C(O2)C=C(C=C3C)O)C
|
|
InChI |
InChI=1S/C14H18O3/c1-8-4-10(15)5-13-11(8)6-12-9(2)7-16-14(12,3)17-13/h4-5,9,12,15H,6-7H2,1-3H3/t9-,12-,14-/m1/s1
|
|
InChIKey |
AYWHVIHSUTWUCM-GAJTVXKRSA-N
|
|
Synonyms |
Alboatrin; (3S,3aR,9aR)-3,5,9a-trimethyl-2,3,3a,4-tetrahydrofuro[2,3-b]chromen-7-ol
|
|
CAS | NA | |
PubChem CID | 10955489 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 234.29 | ALogp: | 3.0 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 38.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 17 | QED Weighted: | 0.747 |
Caco-2 Permeability: | -4.6 | MDCK Permeability: | 0.00002280 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.317 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.738 |
30% Bioavailability (F30%): | 0.111 |
Blood-Brain-Barrier Penetration (BBB): | 0.846 | Plasma Protein Binding (PPB): | 88.54% |
Volume Distribution (VD): | 1.757 | Fu: | 7.28% |
CYP1A2-inhibitor: | 0.394 | CYP1A2-substrate: | 0.699 |
CYP2C19-inhibitor: | 0.296 | CYP2C19-substrate: | 0.807 |
CYP2C9-inhibitor: | 0.125 | CYP2C9-substrate: | 0.709 |
CYP2D6-inhibitor: | 0.154 | CYP2D6-substrate: | 0.871 |
CYP3A4-inhibitor: | 0.2 | CYP3A4-substrate: | 0.425 |
Clearance (CL): | 11.576 | Half-life (T1/2): | 0.683 |
hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.872 |
Drug-inuced Liver Injury (DILI): | 0.674 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.044 | Maximum Recommended Daily Dose: | 0.292 |
Skin Sensitization: | 0.205 | Carcinogencity: | 0.859 |
Eye Corrosion: | 0.01 | Eye Irritation: | 0.593 |
Respiratory Toxicity: | 0.659 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004831 | ![]() |
0.741 | D0P1FO | ![]() |
0.276 | ||
ENC002560 | ![]() |
0.732 | D0L7AS | ![]() |
0.247 | ||
ENC004832 | ![]() |
0.644 | D0W6DG | ![]() |
0.235 | ||
ENC002710 | ![]() |
0.481 | D0K7LU | ![]() |
0.231 | ||
ENC005718 | ![]() |
0.393 | D03XES | ![]() |
0.215 | ||
ENC001963 | ![]() |
0.388 | D07MGA | ![]() |
0.213 | ||
ENC004936 | ![]() |
0.388 | D0P6VV | ![]() |
0.210 | ||
ENC004755 | ![]() |
0.372 | D00ZFP | ![]() |
0.209 | ||
ENC004013 | ![]() |
0.361 | D0T3HY | ![]() |
0.200 | ||
ENC006120 | ![]() |
0.338 | D0O1UZ | ![]() |
0.196 |