![]() |
Name |
Diaportinol
|
Molecular Formula | C13H14O6 | |
IUPAC Name* |
3-[(2R)-2,3-dihydroxypropyl]-8-hydroxy-6-methoxyisochromen-1-one
|
|
SMILES |
COC1=CC(=C2C(=C1)C=C(OC2=O)C[C@H](CO)O)O
|
|
InChI |
InChI=1S/C13H14O6/c1-18-9-2-7-3-10(4-8(15)6-14)19-13(17)12(7)11(16)5-9/h2-3,5,8,14-16H,4,6H2,1H3/t8-/m1/s1
|
|
InChIKey |
BINZCYYNWOVDRD-MRVPVSSYSA-N
|
|
Synonyms |
Diaportinol; CHEMBL4161822
|
|
CAS | NA | |
PubChem CID | 10849348 | |
ChEMBL ID | CHEMBL4161822 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 266.25 | ALogp: | 1.0 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 96.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.756 |
Caco-2 Permeability: | -5.089 | MDCK Permeability: | 0.00005440 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.98 |
Human Intestinal Absorption (HIA): | 0.081 | 20% Bioavailability (F20%): | 0.523 |
30% Bioavailability (F30%): | 0.993 |
Blood-Brain-Barrier Penetration (BBB): | 0.168 | Plasma Protein Binding (PPB): | 72.15% |
Volume Distribution (VD): | 0.992 | Fu: | 24.25% |
CYP1A2-inhibitor: | 0.913 | CYP1A2-substrate: | 0.592 |
CYP2C19-inhibitor: | 0.033 | CYP2C19-substrate: | 0.203 |
CYP2C9-inhibitor: | 0.133 | CYP2C9-substrate: | 0.861 |
CYP2D6-inhibitor: | 0.026 | CYP2D6-substrate: | 0.533 |
CYP3A4-inhibitor: | 0.035 | CYP3A4-substrate: | 0.2 |
Clearance (CL): | 9.388 | Half-life (T1/2): | 0.705 |
hERG Blockers: | 0.045 | Human Hepatotoxicity (H-HT): | 0.537 |
Drug-inuced Liver Injury (DILI): | 0.736 | AMES Toxicity: | 0.109 |
Rat Oral Acute Toxicity: | 0.056 | Maximum Recommended Daily Dose: | 0.908 |
Skin Sensitization: | 0.616 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.508 |
Respiratory Toxicity: | 0.033 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001632 | ![]() |
0.772 | D07MGA | ![]() |
0.270 | ||
ENC005211 | ![]() |
0.772 | D04AIT | ![]() |
0.264 | ||
ENC003380 | ![]() |
0.754 | D04UTT | ![]() |
0.262 | ||
ENC001634 | ![]() |
0.710 | D06GCK | ![]() |
0.260 | ||
ENC005393 | ![]() |
0.625 | D0K8KX | ![]() |
0.258 | ||
ENC001569 | ![]() |
0.607 | D04KJO | ![]() |
0.258 | ||
ENC004556 | ![]() |
0.607 | D0D1DI | ![]() |
0.258 | ||
ENC005394 | ![]() |
0.606 | D0Q1IT | ![]() |
0.258 | ||
ENC002320 | ![]() |
0.606 | D0DJ1B | ![]() |
0.253 | ||
ENC005299 | ![]() |
0.606 | D05CKR | ![]() |
0.250 |