![]() |
Name |
Feigrisolide C
|
Molecular Formula | C21H36O7 | |
IUPAC Name* |
(1S,2S,5S,8R,9R,12S,14R)-8-hydroxy-5-[(2R)-2-hydroxybutyl]-2,9,12-trimethyl-4,11,17-trioxabicyclo[12.2.1]heptadecane-3,10-dione
|
|
SMILES |
CC[C@H](C[C@@H]1CC[C@H]([C@H](C(=O)O[C@H](C[C@H]2CC[C@H](O2)[C@@H](C(=O)O1)C)C)C)O)O
|
|
InChI |
InChI=1S/C21H36O7/c1-5-15(22)11-17-6-8-18(23)13(3)20(24)26-12(2)10-16-7-9-19(27-16)14(4)21(25)28-17/h12-19,22-23H,5-11H2,1-4H3/t12-,13+,14-,15+,16+,17-,18+,19-/m0/s1
|
|
InChIKey |
HQBGZNNKSCTNKH-JWFKEXIPSA-N
|
|
Synonyms |
Feigrisolide C; (1S,2S,5S,8R,9R,12S,14R)-8-Hydroxy-5-[(2R)-2-hydroxybutyl]-2,9,12-trimethyl-4,11,17-trioxabicyclo[12.2.1]heptadecane-3,10-dione
|
|
CAS | NA | |
PubChem CID | 10668706 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 400.5 | ALogp: | 2.8 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 102.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 28 | QED Weighted: | 0.702 |
Caco-2 Permeability: | -4.943 | MDCK Permeability: | 0.00012394 |
Pgp-inhibitor: | 0.159 | Pgp-substrate: | 0.992 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.189 |
Blood-Brain-Barrier Penetration (BBB): | 0.063 | Plasma Protein Binding (PPB): | 41.53% |
Volume Distribution (VD): | 1.986 | Fu: | 37.91% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.07 |
CYP2C19-inhibitor: | 0.009 | CYP2C19-substrate: | 0.483 |
CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.083 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.086 |
CYP3A4-inhibitor: | 0.158 | CYP3A4-substrate: | 0.319 |
Clearance (CL): | 8.91 | Half-life (T1/2): | 0.076 |
hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.956 |
Drug-inuced Liver Injury (DILI): | 0.822 | AMES Toxicity: | 0.259 |
Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.983 |
Skin Sensitization: | 0.947 | Carcinogencity: | 0.672 |
Eye Corrosion: | 0.01 | Eye Irritation: | 0.048 |
Respiratory Toxicity: | 0.825 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005745 | ![]() |
0.450 | D06WTZ | ![]() |
0.258 | ||
ENC004445 | ![]() |
0.353 | D0S3WH | ![]() |
0.257 | ||
ENC004935 | ![]() |
0.321 | D0H0ND | ![]() |
0.234 | ||
ENC005744 | ![]() |
0.292 | D04SFH | ![]() |
0.231 | ||
ENC005743 | ![]() |
0.289 | D02YIZ | ![]() |
0.229 | ||
ENC002040 | ![]() |
0.287 | D0Y7IU | ![]() |
0.227 | ||
ENC001113 | ![]() |
0.286 | D04QNO | ![]() |
0.227 | ||
ENC003456 | ![]() |
0.283 | D04JMQ | ![]() |
0.227 | ||
ENC004418 | ![]() |
0.275 | D0Z1ZM | ![]() |
0.225 | ||
ENC005087 | ![]() |
0.274 | D0M4WA | ![]() |
0.225 |