|
Name |
10-Norparvulenone
|
| Molecular Formula | C12H14O5 | |
| IUPAC Name* |
4,8-dihydroxy-7-(hydroxymethyl)-6-methoxy-3,4-dihydro-2H-naphthalen-1-one
|
|
| SMILES |
COC1=C(C(=C2C(=O)CCC(C2=C1)O)O)CO
|
|
| InChI |
InChI=1S/C12H14O5/c1-17-10-4-6-8(14)2-3-9(15)11(6)12(16)7(10)5-13/h4,8,13-14,16H,2-3,5H2,1H3
|
|
| InChIKey |
NXSUIALRPVXVTA-UHFFFAOYSA-N
|
|
| Synonyms |
10-Norparvulenone; 618104-32-8; 4,8-dihydroxy-7-(hydroxymethyl)-6-methoxy-3,4-dihydro-2H-naphthalen-1-one; 313661-79-9; 3,4-dihydro-4,8-dihydroxy-7-(hydroxymethyl)-6-methoxy-1(2H)-naphthalenone; (+/-)-10-Norparvulenone; MLS004711975; MEGxm0_000227; SCHEMBL16226779; ACon0_001069; ACon1_001421; CHEBI:181472; DTXSID201346895; BS-1501; NCGC00180523-01; SMR003474898; BRD-A00672869-001-01-1; NCGC00180523-02!4,8-dihydroxy-7-(hydroxymethyl)-6-methoxy-3,4-dihydro-2H-naphthalen-1-one
|
|
| CAS | 618104-32-8 | |
| PubChem CID | 9991774 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 238.24 | ALogp: | 0.2 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 17 | QED Weighted: | 0.723 |
| Caco-2 Permeability: | -4.798 | MDCK Permeability: | 0.00000420 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.722 | 20% Bioavailability (F20%): | 0.213 |
| 30% Bioavailability (F30%): | 0.941 |
| Blood-Brain-Barrier Penetration (BBB): | 0.077 | Plasma Protein Binding (PPB): | 68.22% |
| Volume Distribution (VD): | 0.689 | Fu: | 28.67% |
| CYP1A2-inhibitor: | 0.207 | CYP1A2-substrate: | 0.226 |
| CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.297 |
| CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.301 |
| CYP2D6-inhibitor: | 0.039 | CYP2D6-substrate: | 0.294 |
| CYP3A4-inhibitor: | 0.102 | CYP3A4-substrate: | 0.269 |
| Clearance (CL): | 13.929 | Half-life (T1/2): | 0.755 |
| hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.14 |
| Drug-inuced Liver Injury (DILI): | 0.732 | AMES Toxicity: | 0.512 |
| Rat Oral Acute Toxicity: | 0.228 | Maximum Recommended Daily Dose: | 0.013 |
| Skin Sensitization: | 0.875 | Carcinogencity: | 0.16 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.264 |
| Respiratory Toxicity: | 0.282 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003146 | ![]() |
0.804 | D0YH0N | ![]() |
0.308 | ||
| ENC003553 | ![]() |
0.673 | D07MGA | ![]() |
0.289 | ||
| ENC002782 | ![]() |
0.541 | D0J4IX | ![]() |
0.271 | ||
| ENC002781 | ![]() |
0.540 | D07MUN | ![]() |
0.254 | ||
| ENC003360 | ![]() |
0.500 | D09PJX | ![]() |
0.250 | ||
| ENC003000 | ![]() |
0.500 | D02LZB | ![]() |
0.235 | ||
| ENC005719 | ![]() |
0.500 | D07MEH | ![]() |
0.233 | ||
| ENC004189 | ![]() |
0.492 | D0E9CD | ![]() |
0.226 | ||
| ENC002458 | ![]() |
0.491 | D09DHY | ![]() |
0.223 | ||
| ENC004895 | ![]() |
0.433 | D0C9XJ | ![]() |
0.216 | ||