![]() |
Name |
(-)-beta-Elemene
|
Molecular Formula | C15H24 | |
IUPAC Name* |
(1R,2R,4S)-1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane
|
|
SMILES |
CC(=C)[C@H]1CC[C@]([C@H](C1)C(=C)C)(C)C=C
|
|
InChI |
InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,13-14H,1-2,4,8-10H2,3,5-6H3/t13-,14+,15-/m0/s1
|
|
InChIKey |
OPFTUNCRGUEPRZ-ZNMIVQPWSA-N
|
|
Synonyms |
13833-25-5; .beta.-Elemene; 33880-83-0; (-)-.beta.-Elemene; .beta.-Elemen; (+)-beta-elemene; levo-.beta.-Elemene; .beta.-Elemene enantiomer; .beta.-Elemene, (-)-; Cyclohexane, 2,4-diisopropenyl-1-methyl-1-vinyl-, (1S,2R,4R)- (-)-; DTXSID40431930; Cyclohexane, 1-ethenyl-1-methyl-2,4-bis(1-methylethenyl)-, [1S-(1.alpha.,2.beta.,4.beta.)]-; (1R,2R,4S)-1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane; Cyclohexane, 1-ethenyl-1-methyl-2,4-bis(1-methylethenyl)-, (1R,2R,4S)-; ( inverted exclamation markA)-|A-Elemene; EN300-27115302; (1R,2R,4S)-1-Methyl-2,4-di(prop-1-en-2-yl)-1-vinylcyclohexane; 2,4-Diisopropenyl-1-methyl-1-vinylcyclohexane, [1S-(1.alpha.,2.beta.,4.beta.)]-
|
|
CAS | 33880-83-0 | |
PubChem CID | 9859094 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 6.1 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.556 |
Caco-2 Permeability: | -4.551 | MDCK Permeability: | 0.00001740 |
Pgp-inhibitor: | 0.881 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.843 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.147 | Plasma Protein Binding (PPB): | 83.35% |
Volume Distribution (VD): | 2.457 | Fu: | 13.64% |
CYP1A2-inhibitor: | 0.254 | CYP1A2-substrate: | 0.786 |
CYP2C19-inhibitor: | 0.284 | CYP2C19-substrate: | 0.914 |
CYP2C9-inhibitor: | 0.14 | CYP2C9-substrate: | 0.685 |
CYP2D6-inhibitor: | 0.127 | CYP2D6-substrate: | 0.915 |
CYP3A4-inhibitor: | 0.767 | CYP3A4-substrate: | 0.345 |
Clearance (CL): | 4.135 | Half-life (T1/2): | 0.167 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.13 |
Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.012 | Maximum Recommended Daily Dose: | 0.897 |
Skin Sensitization: | 0.392 | Carcinogencity: | 0.147 |
Eye Corrosion: | 0.991 | Eye Irritation: | 0.986 |
Respiratory Toxicity: | 0.208 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001895 | ![]() |
1.000 | D0V8HA | ![]() |
0.203 | ||
ENC002272 | ![]() |
0.400 | D0H1QY | ![]() |
0.193 | ||
ENC001079 | ![]() |
0.379 | D00VZZ | ![]() |
0.184 | ||
ENC001836 | ![]() |
0.379 | D07QKN | ![]() |
0.183 | ||
ENC005066 | ![]() |
0.355 | D0W6DG | ![]() |
0.183 | ||
ENC002124 | ![]() |
0.355 | D04SFH | ![]() |
0.176 | ||
ENC005497 | ![]() |
0.355 | D04CSZ | ![]() |
0.172 | ||
ENC000782 | ![]() |
0.345 | D0S7WX | ![]() |
0.171 | ||
ENC000411 | ![]() |
0.333 | D0F1UL | ![]() |
0.170 | ||
ENC001816 | ![]() |
0.333 | D0B4RU | ![]() |
0.170 |