![]() |
Name |
Altenusin
|
Molecular Formula | C15H14O6 | |
IUPAC Name* |
2-(4,5-dihydroxy-2-methylphenyl)-6-hydroxy-4-methoxybenzoic acid
|
|
SMILES |
CC1=CC(=C(C=C1C2=C(C(=CC(=C2)OC)O)C(=O)O)O)O
|
|
InChI |
InChI=1S/C15H14O6/c1-7-3-11(16)12(17)6-9(7)10-4-8(21-2)5-13(18)14(10)15(19)20/h3-6,16-18H,1-2H3,(H,19,20)
|
|
InChIKey |
ADPBTBPPIIKLEH-UHFFFAOYSA-N
|
|
Synonyms |
Altenusin; 31186-12-6; Alutenusin; 2-(4,5-dihydroxy-2-methylphenyl)-6-hydroxy-4-methoxybenzoic acid; MLS000877038; WM31322YA1; [1,1'-Biphenyl]-2-carboxylicacid, 3,4',5'-trihydroxy-5-methoxy-2'-methyl-; SMR000440664; 3,4',5'-Trihydroxy-5-methoxy-2'-methyl-[1,1'-biphenyl]-2-carboxylic acid; 2-(4,5-dihydroxy-2-methyl-phenyl)-6-hydroxy-4-methoxy-benzoic acid; (1,1'-BIPHENYL)-2-CARBOXYLIC ACID, 3,4',5'-TRIHYDROXY-5-METHOXY-2'-METHYL-; [1,1'-Biphenyl]-2-carboxylic acid, 3,4',5'-trihydroxy-5-methoxy-2'-methyl-; MLS004257367; UNII-WM31322YA1; CHEMBL483531; MEGxm0_000134; Altenusin, >=98% (HPLC); SCHEMBL16224897; ACon0_001034; ACon1_000227; BDBM50576; cid_6918469; DTXSID50953279; CHEBI:141340; HMS2267A11; ZINC13118241; HY-121153; CS-0079551; BRD-K99407061-001-01-8; Q27292712; 4-methoxy-2-[2-methyl-4,5-bis(oxidanyl)phenyl]-6-oxidanyl-benzoic acid; (1,1'-Biphenyl)-2-carboxylic acid, 2,4',5'-trihydroxy-5-methoxy-2'-methyl-; 2,4',5'-Trihydroxy-5-methoxy-2'-methyl-(1,1'-biphenyl)-2-carboxylic acid; 3,4',5'-TRIHYDROXY-5-METHOXY-2'-METHYL(1,1'-BIPHENYL)-2-CARBOXYLIC ACID; NCGC00180762-02!2-(4,5-dihydroxy-2-methylphenyl)-6-hydroxy-4-methoxybenzoic acid; 1402-75-1
|
|
CAS | 31186-12-6 | |
PubChem CID | 6918469 | |
ChEMBL ID | CHEMBL483531 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 290.27 | ALogp: | 2.9 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.646 |
Caco-2 Permeability: | -5.57 | MDCK Permeability: | 0.00000487 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.141 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.212 |
30% Bioavailability (F30%): | 0.864 |
Blood-Brain-Barrier Penetration (BBB): | 0.039 | Plasma Protein Binding (PPB): | 97.76% |
Volume Distribution (VD): | 0.395 | Fu: | 2.58% |
CYP1A2-inhibitor: | 0.46 | CYP1A2-substrate: | 0.838 |
CYP2C19-inhibitor: | 0.038 | CYP2C19-substrate: | 0.046 |
CYP2C9-inhibitor: | 0.331 | CYP2C9-substrate: | 0.158 |
CYP2D6-inhibitor: | 0.248 | CYP2D6-substrate: | 0.165 |
CYP3A4-inhibitor: | 0.069 | CYP3A4-substrate: | 0.063 |
Clearance (CL): | 9.86 | Half-life (T1/2): | 0.881 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.332 |
Drug-inuced Liver Injury (DILI): | 0.98 | AMES Toxicity: | 0.146 |
Rat Oral Acute Toxicity: | 0.037 | Maximum Recommended Daily Dose: | 0.218 |
Skin Sensitization: | 0.142 | Carcinogencity: | 0.026 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.719 |
Respiratory Toxicity: | 0.739 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006073 | ![]() |
0.797 | D04AIT | ![]() |
0.326 | ||
ENC004131 | ![]() |
0.560 | D07MGA | ![]() |
0.315 | ||
ENC002517 | ![]() |
0.541 | D0K8KX | ![]() |
0.303 | ||
ENC002472 | ![]() |
0.539 | D0U3YB | ![]() |
0.289 | ||
ENC002461 | ![]() |
0.533 | D00KRE | ![]() |
0.275 | ||
ENC002518 | ![]() |
0.514 | D0DJ1B | ![]() |
0.272 | ||
ENC005227 | ![]() |
0.507 | D0BA6T | ![]() |
0.267 | ||
ENC000930 | ![]() |
0.507 | D0I3RO | ![]() |
0.267 | ||
ENC002375 | ![]() |
0.500 | D08LFZ | ![]() |
0.265 | ||
ENC005360 | ![]() |
0.480 | D0V9EN | ![]() |
0.264 |