|
Name |
Sulfurous acid, decyl 2-propyl ester
|
| Molecular Formula | C13H28O3S | |
| IUPAC Name* |
decyl propan-2-yl sulfite
|
|
| SMILES |
CCCCCCCCCCOS(=O)OC(C)C
|
|
| InChI |
InChI=1S/C13H28O3S/c1-4-5-6-7-8-9-10-11-12-15-17(14)16-13(2)3/h13H,4-12H2,1-3H3
|
|
| InChIKey |
FJBUSDYACCIUEW-UHFFFAOYSA-N
|
|
| Synonyms |
Sulfurous acid, decyl 2-propyl ester
|
|
| CAS | NA | |
| PubChem CID | 6420364 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 264.43 | ALogp: | 5.5 |
| HBD: | 0 | HBA: | 4 |
| Rotatable Bonds: | 12 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 54.7 | Aromatic Rings: | 0 |
| Heavy Atoms: | 17 | QED Weighted: | 0.478 |
| Caco-2 Permeability: | -4.551 | MDCK Permeability: | 0.00002760 |
| Pgp-inhibitor: | 0.972 | Pgp-substrate: | 0.91 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.015 |
| 30% Bioavailability (F30%): | 0.59 |
| Blood-Brain-Barrier Penetration (BBB): | 0.863 | Plasma Protein Binding (PPB): | 95.85% |
| Volume Distribution (VD): | 1.267 | Fu: | 2.78% |
| CYP1A2-inhibitor: | 0.097 | CYP1A2-substrate: | 0.911 |
| CYP2C19-inhibitor: | 0.041 | CYP2C19-substrate: | 0.898 |
| CYP2C9-inhibitor: | 0.14 | CYP2C9-substrate: | 0.628 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.084 |
| CYP3A4-inhibitor: | 0.022 | CYP3A4-substrate: | 0.134 |
| Clearance (CL): | 6.864 | Half-life (T1/2): | 0.103 |
| hERG Blockers: | 0.051 | Human Hepatotoxicity (H-HT): | 0.883 |
| Drug-inuced Liver Injury (DILI): | 0.952 | AMES Toxicity: | 0.175 |
| Rat Oral Acute Toxicity: | 0.032 | Maximum Recommended Daily Dose: | 0.032 |
| Skin Sensitization: | 0.928 | Carcinogencity: | 0.959 |
| Eye Corrosion: | 0.973 | Eye Irritation: | 0.985 |
| Respiratory Toxicity: | 0.946 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001793 | ![]() |
0.936 | D05ATI | ![]() |
0.469 | ||
| ENC001790 | ![]() |
0.839 | D0Z5SM | ![]() |
0.423 | ||
| ENC001797 | ![]() |
0.709 | D00FGR | ![]() |
0.371 | ||
| ENC001791 | ![]() |
0.662 | D0Y8DP | ![]() |
0.354 | ||
| ENC001795 | ![]() |
0.610 | D05QNO | ![]() |
0.338 | ||
| ENC000490 | ![]() |
0.596 | D07ILQ | ![]() |
0.338 | ||
| ENC000621 | ![]() |
0.558 | D0MM8N | ![]() |
0.314 | ||
| ENC000558 | ![]() |
0.538 | D0O1PH | ![]() |
0.314 | ||
| ENC000850 | ![]() |
0.536 | D0G2KD | ![]() |
0.313 | ||
| ENC001796 | ![]() |
0.536 | D0AY9Q | ![]() |
0.309 | ||