NPs Basic Information
|
Name |
4,5-dichloro-1-[(E)-2-chloroethenyl]-2,4-dimethylcyclohexene
|
| Molecular Formula | C10H13Cl3 | |
| IUPAC Name* |
4,5-dichloro-1-[(E)-2-chloroethenyl]-2,4-dimethylcyclohexene
|
|
| SMILES |
CC1=C(CC(C(C1)(C)Cl)Cl)/C=C/Cl
|
|
| InChI |
InChI=1S/C10H13Cl3/c1-7-6-10(2,13)9(12)5-8(7)3-4-11/h3-4,9H,5-6H2,1-2H3/b4-3+
|
|
| InChIKey |
LAOVFJOKZZYETK-ONEGZZNKSA-N
|
|
| Synonyms |
PC-2; NSC305224; CHEMBL1996631; NSC-305224
|
|
| CAS | NA | |
| PubChem CID | 5458653 | |
| ChEMBL ID | CHEMBL1996631 |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 239.6 | ALogp: | 3.4 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 13 | QED Weighted: | 0.567 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.353 | MDCK Permeability: | 0.00001950 |
| Pgp-inhibitor: | 0.014 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.001 |
| 30% Bioavailability (F30%): | 0 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.64 | Plasma Protein Binding (PPB): | 94.39% |
| Volume Distribution (VD): | 2.422 | Fu: | 4.48% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.933 | CYP1A2-substrate: | 0.939 |
| CYP2C19-inhibitor: | 0.823 | CYP2C19-substrate: | 0.924 |
| CYP2C9-inhibitor: | 0.252 | CYP2C9-substrate: | 0.948 |
| CYP2D6-inhibitor: | 0.928 | CYP2D6-substrate: | 0.902 |
| CYP3A4-inhibitor: | 0.613 | CYP3A4-substrate: | 0.711 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 6.587 | Half-life (T1/2): | 0.486 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.222 |
| Drug-inuced Liver Injury (DILI): | 0.713 | AMES Toxicity: | 0.143 |
| Rat Oral Acute Toxicity: | 0.027 | Maximum Recommended Daily Dose: | 0.124 |
| Skin Sensitization: | 0.417 | Carcinogencity: | 0.648 |
| Eye Corrosion: | 0.583 | Eye Irritation: | 0.793 |
| Respiratory Toxicity: | 0.954 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001425 |  |
0.224 | D0H1QY |  |
0.167 | ||
| ENC000328 |  |
0.212 | D0S7WX |  |
0.167 | ||
| ENC000146 |  |
0.200 | D06XWB |  |
0.167 | ||
| ENC000574 |  |
0.196 | D0G3PI |  |
0.163 | ||
| ENC001294 |  |
0.194 | D02DGU |  |
0.163 | ||
| ENC001739 |  |
0.190 | D00DKK |  |
0.163 | ||
| ENC002989 |  |
0.190 | D0Q4XQ |  |
0.154 | ||
| ENC002418 |  |
0.190 | D0H6VY |  |
0.148 | ||
| ENC002346 |  |
0.190 | D0EJ6O |  |
0.141 | ||
| ENC003951 |  |
0.186 | D0K7LU |  |
0.137 | ||