![]() |
Name |
Asperenone
|
Molecular Formula | C20H22O | |
IUPAC Name* |
(4E,6E,8E,10E,12E)-8-methyl-13-phenyltrideca-4,6,8,10,12-pentaen-3-one
|
|
SMILES |
CCC(=O)/C=C/C=C/C(=C/C=C/C=C/C1=CC=CC=C1)/C
|
|
InChI |
InChI=1S/C20H22O/c1-3-20(21)17-11-10-13-18(2)12-6-4-7-14-19-15-8-5-9-16-19/h4-17H,3H2,1-2H3/b6-4+,13-10+,14-7+,17-11+,18-12+
|
|
InChIKey |
KMNUJIARVHVQCF-SVCWYOIUSA-N
|
|
Synonyms |
Asperenone; Asperenon; Asperenone-; 85FRC9R4ED; 18810-05-4; 4,6,8,10,12-Tridecapentaen-3-one, 8-methyl-13-phenyl-, (all-E)-; (4E,6E,8E,10E,12E)-8-methyl-13-phenyltrideca-4,6,8,10,12-pentaen-3-one; 8-Methyl-13-phenyl-4,6,8,10,12-tridecapentaen-3-one; 4,6,8,10,12-Tridecapentaen-3-one, 8-methyl-13-phenyl-; (All-E)-8-methyl-13-phenyl-4,6,8,10,12-tridecapentaen-3-one; (4E,6E,8E,10E,12E)-8-Methyl-13-phenyl-4,6,8,10,12-tridecapentaen-3-one; (4E,6E,8E,10E,12E)-8-Methyl-13-phenyl-trideca-4,6,8,10,12-pentaen-3-one; (4E,6E,8E,10E,12E)-8-Methyl-13-phenyltrideca-4,6,8,10,12-pentaene-3-one; 4,6,8,10,12-Tridecapentaen-3-one, 8-methyl-13-phenyl-, (4E,6E,8E,10E,12E)-; UNII-85FRC9R4ED; SCHEMBL5693248; SCHEMBL5693250; CHEBI:133813; 8-Methyl-13-phenyl-4,6,8,10,12-tridecapenten-3-one; (4E,6E,8E,10E,12E)-8-Methyl-13-phenyl-4,6,8,10,12-tridecapentaen-3-one #; 178740-27-7
|
|
CAS | 18810-05-4 | |
PubChem CID | 5368642 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 278.4 | ALogp: | 5.7 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 17.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 21 | QED Weighted: | 0.472 |
Caco-2 Permeability: | -4.952 | MDCK Permeability: | 0.00001320 |
Pgp-inhibitor: | 0.107 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.032 | 20% Bioavailability (F20%): | 0.079 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.232 | Plasma Protein Binding (PPB): | 98.62% |
Volume Distribution (VD): | 0.455 | Fu: | 2.76% |
CYP1A2-inhibitor: | 0.886 | CYP1A2-substrate: | 0.214 |
CYP2C19-inhibitor: | 0.947 | CYP2C19-substrate: | 0.145 |
CYP2C9-inhibitor: | 0.823 | CYP2C9-substrate: | 0.996 |
CYP2D6-inhibitor: | 0.82 | CYP2D6-substrate: | 0.956 |
CYP3A4-inhibitor: | 0.918 | CYP3A4-substrate: | 0.118 |
Clearance (CL): | 1.839 | Half-life (T1/2): | 0.195 |
hERG Blockers: | 0.438 | Human Hepatotoxicity (H-HT): | 0.093 |
Drug-inuced Liver Injury (DILI): | 0.403 | AMES Toxicity: | 0.315 |
Rat Oral Acute Toxicity: | 0.022 | Maximum Recommended Daily Dose: | 0.594 |
Skin Sensitization: | 0.936 | Carcinogencity: | 0.745 |
Eye Corrosion: | 0.101 | Eye Irritation: | 0.977 |
Respiratory Toxicity: | 0.463 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000023 | ![]() |
0.391 | D01ZJK | ![]() |
0.379 | ||
ENC001616 | ![]() |
0.386 | D03KOZ | ![]() |
0.297 | ||
ENC001091 | ![]() |
0.379 | D0L1WV | ![]() |
0.267 | ||
ENC001443 | ![]() |
0.360 | D0T3NY | ![]() |
0.263 | ||
ENC001615 | ![]() |
0.328 | D0B7OD | ![]() |
0.263 | ||
ENC002836 | ![]() |
0.316 | D0B1IP | ![]() |
0.250 | ||
ENC004807 | ![]() |
0.315 | D0X9RY | ![]() |
0.250 | ||
ENC002787 | ![]() |
0.309 | D05OFX | ![]() |
0.250 | ||
ENC001736 | ![]() |
0.300 | D07ONP | ![]() |
0.247 | ||
ENC001523 | ![]() |
0.299 | D02IOH | ![]() |
0.242 |