|
Name |
(4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene
|
| Molecular Formula | C15H24 | |
| IUPAC Name* |
(4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene
|
|
| SMILES |
C/C/1=C/CCC(=C)C2CC(C2CC1)(C)C
|
|
| InChI |
InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6-
|
|
| InChIKey |
NPNUFJAVOOONJE-WDZFZDKYSA-N
|
|
| Synonyms |
(4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene; 13877-93-5; Cis-caryophyllene; 54061-81-3; (Z)-4,11,11-Trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene; 87-44-5; .gamma.-Caryophyllene; Bicyclo[7.2.0]undec-4-ene, 4,11,11-trimethyl-8-methylene-,[1R-(1R*,4Z,9S*)]-; .beta.-cis-Caryophyllene; 4,11,11-Trimethyl-8-methylenebicyclo(7.2.0)undec-4-ene; 4,11,11-Trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene; NSC11906; B-Caryophyllene Fcc; Bicyclo(7.2.0)undec-4-ene, 4,11,11-trimethyl-8-methylene-; Cis-.beta.-caryophyllene; 4,11,11-Trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene #; Bicyclo[7.2.0]undec-4-ene, 4,11,11-trimethyl-8-methylene-, (1R,4E,9S)-; Bicyclo[7.2.0]undec-4-ene, 4,11,11-trimethyl-8-methylene-, [1R-(1R*,4E,9S*)]-; BBL001767; MFCD00019271; STK017347; AKOS005378035; VS-00870; 4,11,11-trimethyl-8-methylene-bicyclo[7.2.0]undec-4-ene; 4,11,11-Trimethyl-8-methylenebicyclo[7.2.0]undeca-4-ene; (5Z)-6,10,10-trimethyl-2-methylidenebicyclo[7.2.0]undec-5-ene; (z)-4,11,11-trimethyl-8-methylene-bicyclo[7.2.0]undec-4-ene, AldrichCPR; CIS-4,11,11-TRIMETHYL-8-METHYLENE-BICYCLO(7.2.0)UNDECA-4-ENE; 882299-40-3
|
|
| CAS | 87-44-5 | |
| PubChem CID | 5322111 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 204.35 | ALogp: | 4.4 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 15 | QED Weighted: | 0.478 |
| Caco-2 Permeability: | -4.556 | MDCK Permeability: | 0.00001830 |
| Pgp-inhibitor: | 0.095 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.929 |
| 30% Bioavailability (F30%): | 0.017 |
| Blood-Brain-Barrier Penetration (BBB): | 0.932 | Plasma Protein Binding (PPB): | 93.32% |
| Volume Distribution (VD): | 2.412 | Fu: | 4.04% |
| CYP1A2-inhibitor: | 0.267 | CYP1A2-substrate: | 0.768 |
| CYP2C19-inhibitor: | 0.279 | CYP2C19-substrate: | 0.895 |
| CYP2C9-inhibitor: | 0.232 | CYP2C9-substrate: | 0.871 |
| CYP2D6-inhibitor: | 0.028 | CYP2D6-substrate: | 0.917 |
| CYP3A4-inhibitor: | 0.086 | CYP3A4-substrate: | 0.283 |
| Clearance (CL): | 7.557 | Half-life (T1/2): | 0.16 |
| hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.17 |
| Drug-inuced Liver Injury (DILI): | 0.105 | AMES Toxicity: | 0.016 |
| Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.461 |
| Skin Sensitization: | 0.394 | Carcinogencity: | 0.101 |
| Eye Corrosion: | 0.042 | Eye Irritation: | 0.829 |
| Respiratory Toxicity: | 0.123 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001826 | ![]() |
1.000 | D0L2LS | ![]() |
0.262 | ||
| ENC001663 | ![]() |
0.673 | D0D2VS | ![]() |
0.259 | ||
| ENC002199 | ![]() |
0.519 | D0K0EK | ![]() |
0.250 | ||
| ENC002652 | ![]() |
0.519 | D06CGB | ![]() |
0.247 | ||
| ENC001469 | ![]() |
0.491 | D0A2AJ | ![]() |
0.247 | ||
| ENC001297 | ![]() |
0.446 | D0Z1XD | ![]() |
0.244 | ||
| ENC002990 | ![]() |
0.414 | D0F2AK | ![]() |
0.241 | ||
| ENC001316 | ![]() |
0.414 | D0C7JF | ![]() |
0.241 | ||
| ENC000800 | ![]() |
0.390 | D00ZFP | ![]() |
0.241 | ||
| ENC001279 | ![]() |
0.373 | D04ATM | ![]() |
0.236 | ||