|
Name |
Methyl 2-hydroxy-6-(4-hydroxy-2-methoxy-6-methoxycarbonylphenoxy)-4-methylbenzoate
|
| Molecular Formula | C18H18O8 | |
| IUPAC Name* |
methyl 2-hydroxy-6-(4-hydroxy-2-methoxy-6-methoxycarbonylphenoxy)-4-methylbenzoate
|
|
| SMILES |
CC1=CC(=C(C(=C1)OC2=C(C=C(C=C2OC)O)C(=O)OC)C(=O)OC)O
|
|
| InChI |
InChI=1S/C18H18O8/c1-9-5-12(20)15(18(22)25-4)13(6-9)26-16-11(17(21)24-3)7-10(19)8-14(16)23-2/h5-8,19-20H,1-4H3
|
|
| InChIKey |
KYDNOVLBVBYOSW-UHFFFAOYSA-N
|
|
| Synonyms |
Methyl Asterrate; methyl 2-hydroxy-6-(4-hydroxy-2-methoxy-6-methoxycarbonylphenoxy)-4-methylbenzoate; 59170-17-1; CHEMBL451989; MEGxm0_000386; ACon0_000931; ACon1_000170; CHEBI:181231; DTXSID901346989; ZINC605688; NCGC00180813-01; Methyl asterrate, >=95% (LC/MS-UV); L007435; BRD-K81747381-001-01-0; NCGC00180813-03!methyl 2-hydroxy-6-(4-hydroxy-2-methoxy-6-methoxycarbonylphenoxy)-4-methylbenzoate
|
|
| CAS | 59170-17-1 | |
| PubChem CID | 5249326 | |
| ChEMBL ID | CHEMBL451989 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 362.3 | ALogp: | 3.3 |
| HBD: | 2 | HBA: | 8 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 112.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 26 | QED Weighted: | 0.777 |
| Caco-2 Permeability: | -4.854 | MDCK Permeability: | 0.00002060 |
| Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.012 |
| Human Intestinal Absorption (HIA): | 0.171 | 20% Bioavailability (F20%): | 0.008 |
| 30% Bioavailability (F30%): | 0.098 |
| Blood-Brain-Barrier Penetration (BBB): | 0.141 | Plasma Protein Binding (PPB): | 95.39% |
| Volume Distribution (VD): | 0.605 | Fu: | 8.53% |
| CYP1A2-inhibitor: | 0.952 | CYP1A2-substrate: | 0.89 |
| CYP2C19-inhibitor: | 0.921 | CYP2C19-substrate: | 0.14 |
| CYP2C9-inhibitor: | 0.767 | CYP2C9-substrate: | 0.895 |
| CYP2D6-inhibitor: | 0.649 | CYP2D6-substrate: | 0.66 |
| CYP3A4-inhibitor: | 0.767 | CYP3A4-substrate: | 0.227 |
| Clearance (CL): | 12.523 | Half-life (T1/2): | 0.85 |
| hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.041 |
| Drug-inuced Liver Injury (DILI): | 0.455 | AMES Toxicity: | 0.063 |
| Rat Oral Acute Toxicity: | 0.28 | Maximum Recommended Daily Dose: | 0.768 |
| Skin Sensitization: | 0.359 | Carcinogencity: | 0.014 |
| Eye Corrosion: | 0.005 | Eye Irritation: | 0.773 |
| Respiratory Toxicity: | 0.351 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001490 | ![]() |
0.827 | D06GCK | ![]() |
0.337 | ||
| ENC002526 | ![]() |
0.795 | D09DHY | ![]() |
0.304 | ||
| ENC002663 | ![]() |
0.795 | D04OSE | ![]() |
0.292 | ||
| ENC006015 | ![]() |
0.772 | D07MGA | ![]() |
0.284 | ||
| ENC002381 | ![]() |
0.750 | D02LZB | ![]() |
0.283 | ||
| ENC002468 | ![]() |
0.713 | D0A8FB | ![]() |
0.276 | ||
| ENC005978 | ![]() |
0.713 | D00WVW | ![]() |
0.273 | ||
| ENC005170 | ![]() |
0.682 | D0Y7TS | ![]() |
0.272 | ||
| ENC005416 | ![]() |
0.675 | D0D4HN | ![]() |
0.270 | ||
| ENC001415 | ![]() |
0.636 | D0NJ3V | ![]() |
0.270 | ||