![]() |
Name |
(E)-jasmone
|
Molecular Formula | C11H16O | |
IUPAC Name* |
3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one
|
|
SMILES |
CC/C=C/CC1=C(CCC1=O)C
|
|
InChI |
InChI=1S/C11H16O/c1-3-4-5-6-10-9(2)7-8-11(10)12/h4-5H,3,6-8H2,1-2H3/b5-4+
|
|
InChIKey |
XMLSXPIVAXONDL-SNAWJCMRSA-N
|
|
Synonyms |
Jasmone, (E)-; (E)-jasmone; trans-jasmone; 6261-18-3; 3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one; 2-Cyclopenten-1-one, 3-methyl-2-(2-pentenyl)-, (E)-; 7TCS3Y45DR; 2-Cyclopenten-1-one, 3-methyl-2-(2E)-2-pentenyl-; 2-Cyclopenten-1-one, 3-methyl-2-(2E)-2-penten-1-yl-; (E)-3-methyl-2-(pent-2-en-1-yl)cyclopent-2-en-1-one; UNII-7TCS3Y45DR; EINECS 228-410-7; cis-3-methyl-2-pent-2-enyl-cyclopent-2-enone; JASMONE, TRANS-; SCHEMBL20383; (E)-3-Methyl-2-(pent-2-enyl)cyclopent-2-en-1-one; 3-Methyl-2-(2-pentenyl)-2-cyclopentene-1-one, (E)-; JASMONE TRANS-FORM [MI]; CHEBI:88585; cis-3-methyl-2-pent-2-enyl-cyclopent-2-enone,cis-Jasmon; DTXSID50904403; (E)-methyl pentenyl cyclopentenone; ZINC1531140; AKOS006228065; 68043-00-5; 2-(2-Pentenyl)-3-methyl-2-cyclopenten-1-one; trans-3-methyl-2-pent-2-enyl-cyclopent-2-enone; (E)-3-methyl-2-(pent-2-enyl)cyclopent-2-enone; A827608; 3-Methyl-(cis-2-penten-1-yl)-2-cyclopenten-1-one; 3-methyl-2-[(E)-pent-2-enyl]-1-cyclopent-2-enone; Q27160475; 3-Methyl-2-(2E)-2-penten-1-yl-2-Cyclopenten-1-one; 3-Methyl-2-[(2E)-2-pentenyl]-2-cyclopenten-1-one #; 3-METHYL-2-(TRANS-2-PENTENYL)-2-CYCLOPENTEN-1-ONE; 3-methyl-2-[(2E)-pent-2-en-1-yl]cyclopent-2-en-1-one; 2-Cyclopenten-1-one, 3-methyl-2-(2-pentenyl)-, (E)- (8CI); 2-CYCLOPENTEN-1-ONE, 3-METHYL-2-(2-PENTENYL)-, TRANS-
|
|
CAS | 6261-18-3 | |
PubChem CID | 1549019 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 164.24 | ALogp: | 2.2 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.58 |
Caco-2 Permeability: | -4.469 | MDCK Permeability: | 0.00002650 |
Pgp-inhibitor: | 0.034 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.027 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.519 | Plasma Protein Binding (PPB): | 92.80% |
Volume Distribution (VD): | 0.348 | Fu: | 3.43% |
CYP1A2-inhibitor: | 0.8 | CYP1A2-substrate: | 0.757 |
CYP2C19-inhibitor: | 0.503 | CYP2C19-substrate: | 0.562 |
CYP2C9-inhibitor: | 0.094 | CYP2C9-substrate: | 0.77 |
CYP2D6-inhibitor: | 0.431 | CYP2D6-substrate: | 0.796 |
CYP3A4-inhibitor: | 0.057 | CYP3A4-substrate: | 0.227 |
Clearance (CL): | 5.339 | Half-life (T1/2): | 0.843 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.164 |
Drug-inuced Liver Injury (DILI): | 0.173 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.043 | Maximum Recommended Daily Dose: | 0.718 |
Skin Sensitization: | 0.673 | Carcinogencity: | 0.463 |
Eye Corrosion: | 0.246 | Eye Irritation: | 0.867 |
Respiratory Toxicity: | 0.772 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001840 | ![]() |
0.650 | D09TPF | ![]() |
0.184 | ||
ENC002343 | ![]() |
0.500 | D00IUG | ![]() |
0.182 | ||
ENC000476 | ![]() |
0.421 | D0Q4XQ | ![]() |
0.180 | ||
ENC001746 | ![]() |
0.354 | D05OQJ | ![]() |
0.175 | ||
ENC004598 | ![]() |
0.310 | D0E0WQ | ![]() |
0.175 | ||
ENC005598 | ![]() |
0.305 | D0W0MF | ![]() |
0.172 | ||
ENC001581 | ![]() |
0.305 | D0H6VY | ![]() |
0.169 | ||
ENC005199 | ![]() |
0.281 | D02OZY | ![]() |
0.169 | ||
ENC002548 | ![]() |
0.256 | D03GCJ | ![]() |
0.167 | ||
ENC005292 | ![]() |
0.246 | D00MIN | ![]() |
0.167 |