|
Name |
(S)-(+)-2,2-Dimethyl-1,3-dioxolane-4-methanol
|
| Molecular Formula | C6H12O3 | |
| IUPAC Name* |
[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol
|
|
| SMILES |
CC1(OC[C@@H](O1)CO)C
|
|
| InChI |
InChI=1S/C6H12O3/c1-6(2)8-4-5(3-7)9-6/h5,7H,3-4H2,1-2H3/t5-/m0/s1
|
|
| InChIKey |
RNVYQYLELCKWAN-YFKPBYRVSA-N
|
|
| Synonyms |
22323-82-6; (S)-(+)-2,2-Dimethyl-1,3-dioxolane-4-methanol; [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol; (S)-(+)-1,2-Isopropylideneglycerol; (S)-2,2-Dimethyl-1,3-dioxolane-4-methanol; s-glycerol acetonide; 1,2-Isopropylidene-sn-glycerol; (+)-Solketal; (s)-(+)-2,3-o-isopropylideneglycerol; 1,3-Dioxolane-4-methanol, 2,2-dimethyl-, (4S)-; (S)-(2,2-dimethyl-1,3-dioxolan-4-yl)methanol; D-Acetone glycerol; MFCD00063239; (S)-Solketal; (S)-Glycerol-acetonide; EINECS 244-910-8; 1,3-Dioxolane-4-methanol, 2,2-dimethyl-, (S)-; SCHEMBL221388; 1,2-o-isopropylidene-d-glycerol; 1,2-o-isopropylidene-sn-glycerol; 1,2-o-isopropylidene-sn-glycerine; AM856; DTXSID701317976; ZINC155398; 1,2-o-iso-propylidene-sn-glycerol; D-(+)-1,2-Isopropylideneglycerol; GEO-01176; MFCD00063748; AKOS005257632; AC-6134; CS-W013415; (s)-(+)-1,2-o-isopropylideneglycerol; AS-14052; BP-11488; isopropylideneglycerol (s)-(+)-1,2-o-; DB-027199; D1691; EN300-86444; A23564; F11426; I-8360; S(+)2,2-dimethyl -1,3-dioxolane-4-methanol; (4S)-2,2-Dimethyl-1,3-dioxolan-4-ylmethanol; (4S )-2,2-dimethyl-1,3-dioxolan-4-ylmethanol; (S)-(+)-2,2-dimethyl-1,3-dioxolan-4-methanol; (s)-(2,2-dimethyl-[1,3]dioxolan-4-yl)methanol; (s)-2,2-dimethyl 4-hydroxymethyl-1,3-dioxolane; 323D826; A816104; ((S)-2,2-Dimethyl-[1,3]dioxolan-4-yl)-methanol; (2,2-Dimethyl-1,3-dioxolan-4-yl)methanol, (L)-; (s)-(+)-2,2,-dimethyl-1,3-dioxolane-4-methanol; (S)-(+)-2,2-Dimethyl-1,3-dioxaolane-4-methanol; (S)-(2,2-dimethyl-[1,3]dioxolan-4-yl)-methanol; ((4S)-2,2-dimethyl-1,3-dioxolan-4-yl)methan-1-ol; (4S)-2,2-DIMETHYL-1,3-DIOXOLANE-4-METHANOL; s-(+)-(2,2-dimethyl-[1,3]dioxolan-4-yl)-methanol; (S)-(+)-(2,2-dimethyl-[1,3]dioxolan-4-yl)-methanol; (S)-(+)-2,2-dimethyl-4-(hydroxymethyl)-1,3-dioxolane; (+/-)-2,2-Dimethyl-1,3-dioxolane-4-methanol (Glycerol acetonide); (4S)-(+)-2,2-Dimethyl-4-(hydroxymethyl)-1,3-dioxolane 98%; (S)-(+)-1,2-Isopropylideneglycerol, 98%, optical purity ee: 99% (GLC); [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol;(S)-(+)-2,2-Dimethyl-1,3-dioxolane-4-methanol
|
|
| CAS | 22323-82-6 | |
| PubChem CID | 736057 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 132.16 | ALogp: | -0.2 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 38.7 | Aromatic Rings: | 1 |
| Heavy Atoms: | 9 | QED Weighted: | 0.565 |
| Caco-2 Permeability: | -4.213 | MDCK Permeability: | 0.00030285 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.042 |
| 30% Bioavailability (F30%): | 0.204 |
| Blood-Brain-Barrier Penetration (BBB): | 0.483 | Plasma Protein Binding (PPB): | 15.68% |
| Volume Distribution (VD): | 1.044 | Fu: | 78.91% |
| CYP1A2-inhibitor: | 0.027 | CYP1A2-substrate: | 0.363 |
| CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.839 |
| CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.09 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.196 |
| CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.215 |
| Clearance (CL): | 9.442 | Half-life (T1/2): | 0.802 |
| hERG Blockers: | 0.037 | Human Hepatotoxicity (H-HT): | 0.754 |
| Drug-inuced Liver Injury (DILI): | 0.894 | AMES Toxicity: | 0.989 |
| Rat Oral Acute Toxicity: | 0.036 | Maximum Recommended Daily Dose: | 0.012 |
| Skin Sensitization: | 0.813 | Carcinogencity: | 0.964 |
| Eye Corrosion: | 0.025 | Eye Irritation: | 0.977 |
| Respiratory Toxicity: | 0.007 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001209 | ![]() |
0.290 | D01JQJ | ![]() |
0.308 | ||
| ENC002228 | ![]() |
0.256 | D07VDZ | ![]() |
0.203 | ||
| ENC000051 | ![]() |
0.237 | D0Z9QR | ![]() |
0.158 | ||
| ENC002838 | ![]() |
0.227 | D00AMQ | ![]() |
0.154 | ||
| ENC005200 | ![]() |
0.227 | D0H1QY | ![]() |
0.152 | ||
| ENC000928 | ![]() |
0.211 | D0Z4EI | ![]() |
0.152 | ||
| ENC000927 | ![]() |
0.211 | D02JNM | ![]() |
0.152 | ||
| ENC002306 | ![]() |
0.209 | D04VIS | ![]() |
0.150 | ||
| ENC002574 | ![]() |
0.208 | D0Y2YP | ![]() |
0.149 | ||
| ENC004000 | ![]() |
0.206 | D03MZQ | ![]() |
0.146 | ||