|
Name |
4'-(3-(6-Methyl-3-pyridyl)-1-(p-tolyl)-2-pyrazolin-5-yl)acetanilide
|
| Molecular Formula | C24H24N4O | |
| IUPAC Name* |
N-[4-[2-(4-methylphenyl)-5-(6-methylpyridin-3-yl)-3,4-dihydropyrazol-3-yl]phenyl]acetamide
|
|
| SMILES |
CC1=CC=C(C=C1)N2C(CC(=N2)C3=CN=C(C=C3)C)C4=CC=C(C=C4)NC(=O)C
|
|
| InChI |
InChI=1S/C24H24N4O/c1-16-4-12-22(13-5-16)28-24(19-8-10-21(11-9-19)26-18(3)29)14-23(27-28)20-7-6-17(2)25-15-20/h4-13,15,24H,14H2,1-3H3,(H,26,29)
|
|
| InChIKey |
XIOOGPQXVOUGAR-UHFFFAOYSA-N
|
|
| Synonyms |
4'-(3-(6-Methyl-3-pyridyl)-1-(p-tolyl)-2-pyrazolin-5-yl)acetanilide; 4'-[3-(6-Methyl-3-pyridyl)-1-(p-tolyl)-2-pyrazolin-5-yl]acetanilide; N-(4-[1-(4-Methylphenyl)-3-(6-methyl-3-pyridinyl)-4,5-dihydro-1H-pyrazol-5-yl]phenyl)acetamide #
|
|
| CAS | NA | |
| PubChem CID | 633437 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 384.5 | ALogp: | 3.9 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 57.6 | Aromatic Rings: | 4 |
| Heavy Atoms: | 29 | QED Weighted: | 0.659 |
| Caco-2 Permeability: | -4.742 | MDCK Permeability: | 0.00001670 |
| Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.016 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0 |
| Blood-Brain-Barrier Penetration (BBB): | 0.88 | Plasma Protein Binding (PPB): | 95.95% |
| Volume Distribution (VD): | 1.105 | Fu: | 4.50% |
| CYP1A2-inhibitor: | 0.203 | CYP1A2-substrate: | 0.926 |
| CYP2C19-inhibitor: | 0.493 | CYP2C19-substrate: | 0.513 |
| CYP2C9-inhibitor: | 0.683 | CYP2C9-substrate: | 0.738 |
| CYP2D6-inhibitor: | 0.022 | CYP2D6-substrate: | 0.785 |
| CYP3A4-inhibitor: | 0.335 | CYP3A4-substrate: | 0.932 |
| Clearance (CL): | 0.993 | Half-life (T1/2): | 0.314 |
| hERG Blockers: | 0.738 | Human Hepatotoxicity (H-HT): | 0.952 |
| Drug-inuced Liver Injury (DILI): | 0.973 | AMES Toxicity: | 0.851 |
| Rat Oral Acute Toxicity: | 0.159 | Maximum Recommended Daily Dose: | 0.927 |
| Skin Sensitization: | 0.159 | Carcinogencity: | 0.601 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.94 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000072 | ![]() |
0.270 | D09MGR | ![]() |
0.327 | ||
| ENC001354 | ![]() |
0.267 | D03RTS | ![]() |
0.316 | ||
| ENC000106 | ![]() |
0.266 | D0T1WN | ![]() |
0.313 | ||
| ENC001352 | ![]() |
0.259 | D0F4NS | ![]() |
0.308 | ||
| ENC001224 | ![]() |
0.252 | D0AL8M | ![]() |
0.303 | ||
| ENC003517 | ![]() |
0.246 | D06RUL | ![]() |
0.301 | ||
| ENC000370 | ![]() |
0.242 | D0AZ3C | ![]() |
0.291 | ||
| ENC005492 | ![]() |
0.235 | D08GJO | ![]() |
0.289 | ||
| ENC005414 | ![]() |
0.234 | D0SZ6E | ![]() |
0.288 | ||
| ENC000667 | ![]() |
0.234 | D0VU2X | ![]() |
0.285 | ||