![]() |
Name |
7,9-Dimethylhexadecane
|
Molecular Formula | C18H38 | |
IUPAC Name* |
7,9-dimethylhexadecane
|
|
SMILES |
CCCCCCCC(C)CC(C)CCCCCC
|
|
InChI |
InChI=1S/C18H38/c1-5-7-9-11-13-15-18(4)16-17(3)14-12-10-8-6-2/h17-18H,5-16H2,1-4H3
|
|
InChIKey |
PKDYKLUCVOPIKK-UHFFFAOYSA-N
|
|
Synonyms |
7,9-Dimethylhexadecane; 21164-95-4; HEXADECANE,7,9-DIMETHYL-; Hexadecane, 7,9-dimethyl-
|
|
CAS | NA | |
PubChem CID | 545945 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.5 | ALogp: | 9.4 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 18 | QED Weighted: | 0.313 |
Caco-2 Permeability: | -4.64 | MDCK Permeability: | 0.00000703 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.513 |
30% Bioavailability (F30%): | 0.986 |
Blood-Brain-Barrier Penetration (BBB): | 0.24 | Plasma Protein Binding (PPB): | 98.65% |
Volume Distribution (VD): | 3.554 | Fu: | 1.86% |
CYP1A2-inhibitor: | 0.336 | CYP1A2-substrate: | 0.193 |
CYP2C19-inhibitor: | 0.349 | CYP2C19-substrate: | 0.263 |
CYP2C9-inhibitor: | 0.167 | CYP2C9-substrate: | 0.932 |
CYP2D6-inhibitor: | 0.107 | CYP2D6-substrate: | 0.034 |
CYP3A4-inhibitor: | 0.227 | CYP3A4-substrate: | 0.074 |
Clearance (CL): | 6.195 | Half-life (T1/2): | 0.049 |
hERG Blockers: | 0.149 | Human Hepatotoxicity (H-HT): | 0.011 |
Drug-inuced Liver Injury (DILI): | 0.199 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.014 | Maximum Recommended Daily Dose: | 0.029 |
Skin Sensitization: | 0.95 | Carcinogencity: | 0.03 |
Eye Corrosion: | 0.993 | Eye Irritation: | 0.935 |
Respiratory Toxicity: | 0.226 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001241 | ![]() |
0.692 | D0T9TJ | ![]() |
0.383 | ||
ENC000517 | ![]() |
0.667 | D05ATI | ![]() |
0.366 | ||
ENC001132 | ![]() |
0.635 | D0Z5SM | ![]() |
0.351 | ||
ENC000968 | ![]() |
0.633 | D00MLW | ![]() |
0.340 | ||
ENC001156 | ![]() |
0.630 | D07ILQ | ![]() |
0.325 | ||
ENC001143 | ![]() |
0.625 | D05QNO | ![]() |
0.324 | ||
ENC001155 | ![]() |
0.623 | D00FGR | ![]() |
0.316 | ||
ENC000850 | ![]() |
0.618 | D0P1RL | ![]() |
0.315 | ||
ENC000626 | ![]() |
0.618 | D0D9NY | ![]() |
0.314 | ||
ENC000813 | ![]() |
0.607 | D0XN8C | ![]() |
0.313 |