|
Name |
3,5-Dimethylundecane
|
| Molecular Formula | C13H28 | |
| IUPAC Name* |
3,5-dimethylundecane
|
|
| SMILES |
CCCCCCC(C)CC(C)CC
|
|
| InChI |
InChI=1S/C13H28/c1-5-7-8-9-10-13(4)11-12(3)6-2/h12-13H,5-11H2,1-4H3
|
|
| InChIKey |
YSUJWFQMTUVXNQ-UHFFFAOYSA-N
|
|
| Synonyms |
3,5-Dimethylundecane; Undecane, 3,5-dimethyl-; 17312-81-1; UNDECANE,3,5-DIMETHYL-; 3,5-Dimethylundecan; 3,5-Dimethylundecane #; DTXSID90334003; LMFA11000690
|
|
| CAS | 17312-81-1 | |
| PubChem CID | 519404 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 184.36 | ALogp: | 6.7 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
| Heavy Atoms: | 13 | QED Weighted: | 0.445 |
| Caco-2 Permeability: | -4.426 | MDCK Permeability: | 0.00000969 |
| Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.528 |
| 30% Bioavailability (F30%): | 0.943 |
| Blood-Brain-Barrier Penetration (BBB): | 0.54 | Plasma Protein Binding (PPB): | 97.52% |
| Volume Distribution (VD): | 2.951 | Fu: | 2.21% |
| CYP1A2-inhibitor: | 0.897 | CYP1A2-substrate: | 0.418 |
| CYP2C19-inhibitor: | 0.536 | CYP2C19-substrate: | 0.732 |
| CYP2C9-inhibitor: | 0.486 | CYP2C9-substrate: | 0.854 |
| CYP2D6-inhibitor: | 0.082 | CYP2D6-substrate: | 0.05 |
| CYP3A4-inhibitor: | 0.217 | CYP3A4-substrate: | 0.137 |
| Clearance (CL): | 8.238 | Half-life (T1/2): | 0.128 |
| hERG Blockers: | 0.046 | Human Hepatotoxicity (H-HT): | 0.014 |
| Drug-inuced Liver Injury (DILI): | 0.092 | AMES Toxicity: | 0.004 |
| Rat Oral Acute Toxicity: | 0.024 | Maximum Recommended Daily Dose: | 0.026 |
| Skin Sensitization: | 0.873 | Carcinogencity: | 0.044 |
| Eye Corrosion: | 0.992 | Eye Irritation: | 0.971 |
| Respiratory Toxicity: | 0.297 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001241 | ![]() |
0.780 | D0N3NO | ![]() |
0.267 | ||
| ENC000554 | ![]() |
0.722 | D0ZI4H | ![]() |
0.267 | ||
| ENC001144 | ![]() |
0.718 | D0AY9Q | ![]() |
0.262 | ||
| ENC000797 | ![]() |
0.711 | D0T9TJ | ![]() |
0.255 | ||
| ENC000583 | ![]() |
0.707 | D02MLW | ![]() |
0.244 | ||
| ENC000769 | ![]() |
0.707 | D05ATI | ![]() |
0.242 | ||
| ENC001132 | ![]() |
0.667 | D03LGY | ![]() |
0.239 | ||
| ENC001156 | ![]() |
0.659 | D01QLH | ![]() |
0.239 | ||
| ENC001174 | ![]() |
0.634 | D0X4FM | ![]() |
0.236 | ||
| ENC000519 | ![]() |
0.625 | D0G2KD | ![]() |
0.228 | ||