|
Name |
1,3,5-Tris(trimethylsiloxy)benzene
|
| Molecular Formula | C15H30O3Si3 | |
| IUPAC Name* |
[3,5-bis(trimethylsilyloxy)phenoxy]-trimethylsilane
|
|
| SMILES |
C[Si](C)(C)OC1=CC(=CC(=C1)O[Si](C)(C)C)O[Si](C)(C)C
|
|
| InChI |
InChI=1S/C15H30O3Si3/c1-19(2,3)16-13-10-14(17-20(4,5)6)12-15(11-13)18-21(7,8)9/h10-12H,1-9H3
|
|
| InChIKey |
PXHSJMJQTOFLAS-UHFFFAOYSA-N
|
|
| Synonyms |
1,3,5-Tris(trimethylsiloxy)benzene; Silane, [1,3,5-benzenetriyltris(oxy)]tris[trimethyl-; 10586-12-6; Phloroglucinol, tris-TMS; SCHEMBL9517612; 1,3,5-Benzetriol, 3TMS derivative; 1,3,5-tris(trimethylsilyl-oxy)benzene; Benzene, 1,3,5-tris-trimethylsilyloxy; Pertrimethylsilyl ether of phloroglucinol; Phloroglucinol, tris(trimethylsilyl ether); 1,3,5-Benzenetriyltris(oxy)tris(trimethylsilane); Silane, [1,3,5-benzenetriyltris(oxy)]tris*trimethyl-; (3,5-Bis[(trimethylsilyl)oxy]phenoxy)(trimethyl)silane
|
|
| CAS | NA | |
| PubChem CID | 517874 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 342.65 | ALogp: | 5.3 |
| HBD: | 0 | HBA: | 3 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 27.7 | Aromatic Rings: | 1 |
| Heavy Atoms: | 21 | QED Weighted: | 0.632 |
| Caco-2 Permeability: | -5.005 | MDCK Permeability: | 0.00003530 |
| Pgp-inhibitor: | 0.018 | Pgp-substrate: | 0.004 |
| Human Intestinal Absorption (HIA): | 0.977 | 20% Bioavailability (F20%): | 0.249 |
| 30% Bioavailability (F30%): | 0.021 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 98.24% |
| Volume Distribution (VD): | 4.96 | Fu: | 12.20% |
| CYP1A2-inhibitor: | 0.932 | CYP1A2-substrate: | 0.988 |
| CYP2C19-inhibitor: | 0.126 | CYP2C19-substrate: | 0.928 |
| CYP2C9-inhibitor: | 0.456 | CYP2C9-substrate: | 0.94 |
| CYP2D6-inhibitor: | 0.051 | CYP2D6-substrate: | 0.874 |
| CYP3A4-inhibitor: | 0.031 | CYP3A4-substrate: | 0.226 |
| Clearance (CL): | 3.204 | Half-life (T1/2): | 0.346 |
| hERG Blockers: | 0.096 | Human Hepatotoxicity (H-HT): | 0.003 |
| Drug-inuced Liver Injury (DILI): | 0.02 | AMES Toxicity: | 0.021 |
| Rat Oral Acute Toxicity: | 0 | Maximum Recommended Daily Dose: | 0.107 |
| Skin Sensitization: | 0.918 | Carcinogencity: | 0.038 |
| Eye Corrosion: | 0.998 | Eye Irritation: | 0.989 |
| Respiratory Toxicity: | 0.041 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001123 | ![]() |
0.548 | D07XYV | ![]() |
0.208 | ||
| ENC001149 | ![]() |
0.487 | D0B0AX | ![]() |
0.165 | ||
| ENC001182 | ![]() |
0.434 | D09GYT | ![]() |
0.160 | ||
| ENC001404 | ![]() |
0.355 | D08USJ | ![]() |
0.157 | ||
| ENC000530 | ![]() |
0.346 | D01JFT | ![]() |
0.155 | ||
| ENC001270 | ![]() |
0.338 | D0S5CH | ![]() |
0.151 | ||
| ENC001272 | ![]() |
0.321 | D0A8FB | ![]() |
0.148 | ||
| ENC001385 | ![]() |
0.301 | D0NJ3V | ![]() |
0.147 | ||
| ENC001175 | ![]() |
0.288 | D0WY5Q | ![]() |
0.146 | ||
| ENC000373 | ![]() |
0.263 | D0H2DQ | ![]() |
0.144 | ||