![]() |
Name |
4-Acetamidobutanal
|
Molecular Formula | C6H11NO2 | |
IUPAC Name* |
N-(4-oxobutyl)acetamide
|
|
SMILES |
CC(=O)NCCCC=O
|
|
InChI |
InChI=1S/C6H11NO2/c1-6(9)7-4-2-3-5-8/h5H,2-4H2,1H3,(H,7,9)
|
|
InChIKey |
DDSLGZOYEPKPSJ-UHFFFAOYSA-N
|
|
Synonyms |
4-acetamidobutanal; N-(4-oxobutyl)acetamide; N4-Acetylaminobutanal; 24431-54-7; N-acetyl-4-aminobutanal; 4-(acetylamino)butanal; 4-Acetamidobutyraldehyde; C05936; SCHEMBL293574; CHEBI:7386; N-acetyl-gamma-aminobutyraldehyde; DTXSID30331531; AKOS006348119; EN300-7233403; Q27107484
|
|
CAS | 24431-54-7 | |
PubChem CID | 440850 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 129.16 | ALogp: | -0.7 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.2 | Aromatic Rings: | 0 |
Heavy Atoms: | 9 | QED Weighted: | 0.444 |
Caco-2 Permeability: | -4.44 | MDCK Permeability: | 0.00002140 |
Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.108 |
Human Intestinal Absorption (HIA): | 0.023 | 20% Bioavailability (F20%): | 0.175 |
30% Bioavailability (F30%): | 0.283 |
Blood-Brain-Barrier Penetration (BBB): | 0.928 | Plasma Protein Binding (PPB): | 22.83% |
Volume Distribution (VD): | 1.181 | Fu: | 86.49% |
CYP1A2-inhibitor: | 0.023 | CYP1A2-substrate: | 0.109 |
CYP2C19-inhibitor: | 0.029 | CYP2C19-substrate: | 0.336 |
CYP2C9-inhibitor: | 0.012 | CYP2C9-substrate: | 0.106 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.219 |
CYP3A4-inhibitor: | 0.005 | CYP3A4-substrate: | 0.131 |
Clearance (CL): | 4.285 | Half-life (T1/2): | 0.745 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.06 |
Drug-inuced Liver Injury (DILI): | 0.033 | AMES Toxicity: | 0.775 |
Rat Oral Acute Toxicity: | 0.04 | Maximum Recommended Daily Dose: | 0.04 |
Skin Sensitization: | 0.852 | Carcinogencity: | 0.012 |
Eye Corrosion: | 0.022 | Eye Irritation: | 0.533 |
Respiratory Toxicity: | 0.155 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001900 | ![]() |
0.515 | D0GC2M | ![]() |
0.486 | ||
ENC001205 | ![]() |
0.340 | D0R9BG | ![]() |
0.250 | ||
ENC000032 | ![]() |
0.324 | D06XGW | ![]() |
0.225 | ||
ENC000606 | ![]() |
0.300 | D0AN7B | ![]() |
0.220 | ||
ENC000524 | ![]() |
0.290 | D06OIV | ![]() |
0.217 | ||
ENC000693 | ![]() |
0.289 | D07SJT | ![]() |
0.216 | ||
ENC006075 | ![]() |
0.288 | D01OXI | ![]() |
0.216 | ||
ENC000267 | ![]() |
0.279 | D0EP8X | ![]() |
0.200 | ||
ENC000870 | ![]() |
0.277 | D0A8CJ | ![]() |
0.195 | ||
ENC001287 | ![]() |
0.263 | D0G4JI | ![]() |
0.194 |