|
Name |
Pestalotin
|
| Molecular Formula | C11H18O4 | |
| IUPAC Name* |
(2S)-2-[(1S)-1-hydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one
|
|
| SMILES |
CCCC[C@@H]([C@@H]1CC(=CC(=O)O1)OC)O
|
|
| InChI |
InChI=1S/C11H18O4/c1-3-4-5-9(12)10-6-8(14-2)7-11(13)15-10/h7,9-10,12H,3-6H2,1-2H3/t9-,10-/m0/s1
|
|
| InChIKey |
YFIMUDXPJZVJJO-UWVGGRQHSA-N
|
|
| Synonyms |
Pestalotin; 34565-32-7; (+/-)-Pestalotin; (2S)-2-[(1S)-1-hydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one; (-)-pestalotin; C11H18O4; (2S)-2-((1S)-1-Hydroxypentyl)-4-methoxy-2,3-dihydropyran-6-one; 6-(1-hydroxypentyl)-4-methoxy-5,6-dihydro-2H-pyran-2-one; ACon1_001546; DTXSID20956075; CHEBI:182798; ZINC5821894; (6S)-6-[(1S)-1-Hydroxypentyl]-4-methoxy-5,6-dihydro-2H-pyran-2-one; NCGC00180394-01; HY-119328; CS-0067052; BRD-K86217670-001-01-9; NCGC00180394-02!(2S)-2-[(1S)-1-hydroxypentyl]-4-methoxy-2,3-dihydropyran-6-one
|
|
| CAS | 34565-32-7 | |
| PubChem CID | 182201 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 214.26 | ALogp: | 1.6 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 55.8 | Aromatic Rings: | 1 |
| Heavy Atoms: | 15 | QED Weighted: | 0.71 |
| Caco-2 Permeability: | -4.55 | MDCK Permeability: | 0.00004520 |
| Pgp-inhibitor: | 0.152 | Pgp-substrate: | 0.098 |
| Human Intestinal Absorption (HIA): | 0.022 | 20% Bioavailability (F20%): | 0.161 |
| 30% Bioavailability (F30%): | 0.979 |
| Blood-Brain-Barrier Penetration (BBB): | 0.735 | Plasma Protein Binding (PPB): | 34.39% |
| Volume Distribution (VD): | 0.635 | Fu: | 52.02% |
| CYP1A2-inhibitor: | 0.133 | CYP1A2-substrate: | 0.301 |
| CYP2C19-inhibitor: | 0.088 | CYP2C19-substrate: | 0.836 |
| CYP2C9-inhibitor: | 0.045 | CYP2C9-substrate: | 0.229 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.304 |
| CYP3A4-inhibitor: | 0.074 | CYP3A4-substrate: | 0.305 |
| Clearance (CL): | 12.753 | Half-life (T1/2): | 0.864 |
| hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.322 |
| Drug-inuced Liver Injury (DILI): | 0.206 | AMES Toxicity: | 0.076 |
| Rat Oral Acute Toxicity: | 0.556 | Maximum Recommended Daily Dose: | 0.822 |
| Skin Sensitization: | 0.966 | Carcinogencity: | 0.499 |
| Eye Corrosion: | 0.902 | Eye Irritation: | 0.954 |
| Respiratory Toxicity: | 0.768 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005857 | ![]() |
1.000 | D0L1WV | ![]() |
0.304 | ||
| ENC002876 | ![]() |
0.647 | D0ZI4H | ![]() |
0.224 | ||
| ENC005201 | ![]() |
0.647 | D0N3NO | ![]() |
0.211 | ||
| ENC005858 | ![]() |
0.647 | D0CT4D | ![]() |
0.209 | ||
| ENC002838 | ![]() |
0.479 | D0V0IX | ![]() |
0.207 | ||
| ENC005200 | ![]() |
0.479 | D01WUA | ![]() |
0.200 | ||
| ENC005577 | ![]() |
0.456 | D07AHW | ![]() |
0.200 | ||
| ENC000899 | ![]() |
0.426 | D0L7AS | ![]() |
0.198 | ||
| ENC005564 | ![]() |
0.390 | D00HCQ | ![]() |
0.198 | ||
| ENC005892 | ![]() |
0.360 | D0Y3KG | ![]() |
0.196 | ||