|
Name |
Cyperine
|
| Molecular Formula | C15H16O4 | |
| IUPAC Name* |
2-(3-hydroxy-5-methylphenoxy)-5-methoxy-3-methylphenol
|
|
| SMILES |
CC1=CC(=CC(=C1)OC2=C(C=C(C=C2C)OC)O)O
|
|
| InChI |
InChI=1S/C15H16O4/c1-9-4-11(16)7-13(5-9)19-15-10(2)6-12(18-3)8-14(15)17/h4-8,16-17H,1-3H3
|
|
| InChIKey |
KXXZLMLLYMPYJE-UHFFFAOYSA-N
|
|
| Synonyms |
Cyperine; 33716-82-4; 2-(3-hydroxy-5-methylphenoxy)-5-methoxy-3-methylphenol; CHEBI:4041; 3,5'-Dimethyl-5-methoxy-(2,3'-oxybisphenol); Cyperin; Cy[erom; Antibiotic LL-V125a; C09923; LL-V125a; CHEMBL487020; MEGxm0_000353; ACon0_001000; ACon1_001039; DTXSID10955330; Phenol, 2-(3-hydroxy-5-methylphenoxy)-5-methoxy-3-methyl-; ZINC899558; BS-1515; NCGC00169734-01; 2,3'-dihydroxy-4-methoxy-5',6-dimethyl diphenylether; BRD-K96563692-001-01-8; Q27106294; 2-(3-Hydroxy-5-methylphenoxy)-5-methoxy-3-methylphenol, 9CI; Cyperine; 2,3'-Dihydroxy-4-methoxy-5',6-dimethyl diphenyl ether; LL-V-125-a|or LL-VI-25a
|
|
| CAS | 33716-82-4 | |
| PubChem CID | 182142 | |
| ChEMBL ID | CHEMBL487020 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 260.28 | ALogp: | 3.4 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 58.9 | Aromatic Rings: | 2 |
| Heavy Atoms: | 19 | QED Weighted: | 0.866 |
| Caco-2 Permeability: | -4.953 | MDCK Permeability: | 0.00001520 |
| Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.135 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.959 |
| 30% Bioavailability (F30%): | 0.424 |
| Blood-Brain-Barrier Penetration (BBB): | 0.044 | Plasma Protein Binding (PPB): | 99.11% |
| Volume Distribution (VD): | 0.586 | Fu: | 1.49% |
| CYP1A2-inhibitor: | 0.971 | CYP1A2-substrate: | 0.918 |
| CYP2C19-inhibitor: | 0.784 | CYP2C19-substrate: | 0.203 |
| CYP2C9-inhibitor: | 0.518 | CYP2C9-substrate: | 0.93 |
| CYP2D6-inhibitor: | 0.868 | CYP2D6-substrate: | 0.917 |
| CYP3A4-inhibitor: | 0.524 | CYP3A4-substrate: | 0.348 |
| Clearance (CL): | 12.221 | Half-life (T1/2): | 0.856 |
| hERG Blockers: | 0.064 | Human Hepatotoxicity (H-HT): | 0.085 |
| Drug-inuced Liver Injury (DILI): | 0.072 | AMES Toxicity: | 0.032 |
| Rat Oral Acute Toxicity: | 0.208 | Maximum Recommended Daily Dose: | 0.942 |
| Skin Sensitization: | 0.958 | Carcinogencity: | 0.112 |
| Eye Corrosion: | 0.246 | Eye Irritation: | 0.968 |
| Respiratory Toxicity: | 0.773 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004643 | ![]() |
0.754 | D06GCK | ![]() |
0.315 | ||
| ENC002944 | ![]() |
0.677 | D07MGA | ![]() |
0.299 | ||
| ENC005122 | ![]() |
0.656 | D0S6JG | ![]() |
0.267 | ||
| ENC005402 | ![]() |
0.631 | D01XNB | ![]() |
0.266 | ||
| ENC005290 | ![]() |
0.574 | D0C6DT | ![]() |
0.266 | ||
| ENC002445 | ![]() |
0.571 | D04AIT | ![]() |
0.264 | ||
| ENC005289 | ![]() |
0.571 | D04UTT | ![]() |
0.262 | ||
| ENC005291 | ![]() |
0.548 | D06RGG | ![]() |
0.261 | ||
| ENC005123 | ![]() |
0.536 | D03TPR | ![]() |
0.261 | ||
| ENC004152 | ![]() |
0.533 | D0B0AX | ![]() |
0.257 | ||