|
Name |
Ethyl 2-(2-acetyl-3,5-dihydroxyphenyl)acetate
|
| Molecular Formula | C12H14O5 | |
| IUPAC Name* |
ethyl 2-(2-acetyl-3,5-dihydroxyphenyl)acetate
|
|
| SMILES |
CCOC(=O)CC1=C(C(=CC(=C1)O)O)C(=O)C
|
|
| InChI |
InChI=1S/C12H14O5/c1-3-17-11(16)5-8-4-9(14)6-10(15)12(8)7(2)13/h4,6,14-15H,3,5H2,1-2H3
|
|
| InChIKey |
TURXCFUGBPBPRS-UHFFFAOYSA-N
|
|
| Synonyms |
CURVULIN; 19054-27-4; ethyl 2-(2-acetyl-3,5-dihydroxyphenyl)acetate; Benzeneacetic acid, 2-acetyl-3,5-dihydroxy-, ethyl ester; 2-Acetyl-3,5-dihydroxyphenylacetic acid ethyl ester; ethyl 2-acetyl-3,5-dihydroxyphenylacetate; DTXSID00940619; CHEBI:181254; EX-A6759; ZINC5855988; HB3854; BS-1455; HY-119692; CS-0077820; ethyl (2-acetyl-3,5-dihydroxyphenyl)acetate; J-012300; NCGC00386069-01!ethyl 2-(2-acetyl-3,5-dihydroxyphenyl)acetate
|
|
| CAS | 19054-27-4 | |
| PubChem CID | 177045 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 238.24 | ALogp: | 1.6 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 83.8 | Aromatic Rings: | 1 |
| Heavy Atoms: | 17 | QED Weighted: | 0.618 |
| Caco-2 Permeability: | -4.631 | MDCK Permeability: | 0.00002130 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.012 |
| Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.062 |
| 30% Bioavailability (F30%): | 0.166 |
| Blood-Brain-Barrier Penetration (BBB): | 0.073 | Plasma Protein Binding (PPB): | 69.47% |
| Volume Distribution (VD): | 0.843 | Fu: | 37.14% |
| CYP1A2-inhibitor: | 0.969 | CYP1A2-substrate: | 0.277 |
| CYP2C19-inhibitor: | 0.573 | CYP2C19-substrate: | 0.064 |
| CYP2C9-inhibitor: | 0.536 | CYP2C9-substrate: | 0.846 |
| CYP2D6-inhibitor: | 0.642 | CYP2D6-substrate: | 0.227 |
| CYP3A4-inhibitor: | 0.689 | CYP3A4-substrate: | 0.214 |
| Clearance (CL): | 13.831 | Half-life (T1/2): | 0.924 |
| hERG Blockers: | 0.045 | Human Hepatotoxicity (H-HT): | 0.086 |
| Drug-inuced Liver Injury (DILI): | 0.735 | AMES Toxicity: | 0.176 |
| Rat Oral Acute Toxicity: | 0.043 | Maximum Recommended Daily Dose: | 0.023 |
| Skin Sensitization: | 0.632 | Carcinogencity: | 0.052 |
| Eye Corrosion: | 0.229 | Eye Irritation: | 0.949 |
| Respiratory Toxicity: | 0.359 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002370 | ![]() |
0.680 | D0Y6KO | ![]() |
0.338 | ||
| ENC002055 | ![]() |
0.612 | D0J1VY | ![]() |
0.288 | ||
| ENC004914 | ![]() |
0.594 | D0YF3X | ![]() |
0.271 | ||
| ENC003189 | ![]() |
0.594 | D0T8VY | ![]() |
0.253 | ||
| ENC004672 | ![]() |
0.576 | D0U0OT | ![]() |
0.250 | ||
| ENC003027 | ![]() |
0.563 | D0HD9K | ![]() |
0.236 | ||
| ENC002382 | ![]() |
0.554 | D0BA6T | ![]() |
0.235 | ||
| ENC004779 | ![]() |
0.554 | D06TNL | ![]() |
0.234 | ||
| ENC004671 | ![]() |
0.545 | D07EXH | ![]() |
0.232 | ||
| ENC003972 | ![]() |
0.500 | D02UFG | ![]() |
0.232 | ||