|
Name |
Aurasperone D
|
| Molecular Formula | C31H24O10 | |
| IUPAC Name* |
7-(5,6-dihydroxy-8-methoxy-2-methyl-4-oxobenzo[g]chromen-10-yl)-5-hydroxy-6,8-dimethoxy-2-methylbenzo[g]chromen-4-one
|
|
| SMILES |
CC1=CC(=O)C2=C(O1)C=C3C=C(C(=C(C3=C2O)OC)C4=C5C(=C(C6=C4C=C(C=C6O)OC)O)C(=O)C=C(O5)C)OC
|
|
| InChI |
InChI=1S/C31H24O10/c1-12-6-17(32)25-21(40-12)9-14-8-20(38-4)27(30(39-5)22(14)28(25)35)24-16-10-15(37-3)11-19(34)23(16)29(36)26-18(33)7-13(2)41-31(24)26/h6-11,34-36H,1-5H3
|
|
| InChIKey |
DVSATZLPJVYIRI-UHFFFAOYSA-N
|
|
| Synonyms |
Aurasperone D; 67924-64-5; (7,10'-Bi-4H-naphtho(2,3-b)pyran)-4,4'-dione, 5,5',6'-trihydroxy-6,8,8'-trimethoxy-2,2'-dimethyl-; BRN 1445809; UNII-1521994599; 5-19-07-00182 (Beilstein Handbook Reference); CHEBI:2925; DTXSID80218141; C08995; Q27105883; (7,10'-BI-4H-NAPHTHO(2,3-B)PYRAN)-4,4'-DIONE, 5,5',6'-TRIHYDROXY-6,8,8'-TRIMETHOXY-2,2'-DIMETHYL-, (S)-; 5,6-dihydroxy-10-{5-hydroxy-6,8-dimethoxy-2-methyl-4-oxo-4H-benzo[g]chromen-7-yl}-8-methoxy-2-methyl-4H-benzo[g]chromen-4-one
|
|
| CAS | 67924-64-5 | |
| PubChem CID | 155008 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 556.5 | ALogp: | 6.0 |
| HBD: | 3 | HBA: | 10 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 141.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 41 | QED Weighted: | 0.228 |
| Caco-2 Permeability: | -5.166 | MDCK Permeability: | 0.00001720 |
| Pgp-inhibitor: | 0.905 | Pgp-substrate: | 0.102 |
| Human Intestinal Absorption (HIA): | 0.703 | 20% Bioavailability (F20%): | 0.001 |
| 30% Bioavailability (F30%): | 0.909 |
| Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 70.48% |
| Volume Distribution (VD): | 0.47 | Fu: | 47.83% |
| CYP1A2-inhibitor: | 0.282 | CYP1A2-substrate: | 0.983 |
| CYP2C19-inhibitor: | 0.392 | CYP2C19-substrate: | 0.149 |
| CYP2C9-inhibitor: | 0.745 | CYP2C9-substrate: | 0.891 |
| CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.781 |
| CYP3A4-inhibitor: | 0.062 | CYP3A4-substrate: | 0.153 |
| Clearance (CL): | 2.369 | Half-life (T1/2): | 0.138 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.152 |
| Drug-inuced Liver Injury (DILI): | 0.982 | AMES Toxicity: | 0.134 |
| Rat Oral Acute Toxicity: | 0.101 | Maximum Recommended Daily Dose: | 0.931 |
| Skin Sensitization: | 0.241 | Carcinogencity: | 0.017 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.543 |
| Respiratory Toxicity: | 0.066 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001501 | ![]() |
0.877 | D06GCK | ![]() |
0.379 | ||
| ENC000912 | ![]() |
0.868 | D0G4KG | ![]() |
0.297 | ||
| ENC002093 | ![]() |
0.832 | D04AIT | ![]() |
0.267 | ||
| ENC003507 | ![]() |
0.823 | D06NSS | ![]() |
0.246 | ||
| ENC003154 | ![]() |
0.817 | D03RTK | ![]() |
0.245 | ||
| ENC002002 | ![]() |
0.789 | D09DHY | ![]() |
0.245 | ||
| ENC001411 | ![]() |
0.766 | D02LZB | ![]() |
0.245 | ||
| ENC002884 | ![]() |
0.652 | D0K8KX | ![]() |
0.245 | ||
| ENC003149 | ![]() |
0.650 | D0FX2Q | ![]() |
0.242 | ||
| ENC000984 | ![]() |
0.650 | D0FA2O | ![]() |
0.240 | ||