|
Name |
Gibberellin A4
|
| Molecular Formula | C19H24O5 | |
| IUPAC Name* |
(1R,2R,5R,8R,9S,10R,11S,12S)-12-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid
|
|
| SMILES |
C[C@@]12[C@H](CC[C@@]3([C@@H]1[C@@H]([C@]45[C@H]3CC[C@H](C4)C(=C)C5)C(=O)O)OC2=O)O
|
|
| InChI |
InChI=1S/C19H24O5/c1-9-7-18-8-10(9)3-4-11(18)19-6-5-12(20)17(2,16(23)24-19)14(19)13(18)15(21)22/h10-14,20H,1,3-8H2,2H3,(H,21,22)/t10-,11-,12+,13-,14-,17-,18+,19-/m1/s1
|
|
| InChIKey |
RSQSQJNRHICNNH-NFMPGMCNSA-N
|
|
| Synonyms |
Gibberellin A4; 468-44-0; gibberellin 4; GA4; CHEBI:32902; 1360M56KLC; Gibberellic acid A4; 1,4a-lactone; Gibbane-1,10-dicarboxylic acid, 2,4a-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)-; EINECS 207-406-9; Epitope ID:158628; SCHEMBL385180; UNII-1360M56KLC; DTXSID20896861; 4a.alpha.,4b.beta.-Gibbane-1.alpha.,10.beta.-dicarboxylic acid, 2.beta.,4a-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone; ZINC4102247; MFCD10566789; AKOS026751551; DB07815; NCGC00380182-01; 4aalpha,4bbeta-Gibbane-1alpha,10beta-dicarboxylic acid, 2beta,4a-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone; Gibbane-1,10-dicarboxylic acid, 2,4a-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1alpha,2beta,4aalpha,4bbeta,10beta)-; CS-0144214; E75836; W-106084; Q27097025; (1R,2R,5R,8R,9S,10R,11S,12S)-12-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1(5,8).0(1,10).0(2,8)]heptadecane-9-carboxylic acid; (1S,2S,4aR,4bR,7R,9aR,10S,10aR)-2-Hydroxy-1-methyl-8-methylene-13-oxododecahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid; (1S,2S,4aR,4bR,7R,9aR,10S,10aR)-2-Hydroxy-1-methyl-8-methylene-13-oxododecahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylicacid; (1S,2S,4aR,4bR,7R,9aR,10S,10aR)-2-hydroxy-1-methyl-8-methylidene-13-oxododecahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid; 2beta,4a-dihydroxy-1-methyl-8-methylene-4aalpha,4bbeta-gibbane-1alpha,10beta-dicarboxylic acid; 2beta,4a-dihydroxy-1-methyl-8-methylene-4aalpha,4bbeta-gibbane-1alpha,10beta-dicarboxylic acid, 1,4a-lactone; 2beta-hydroxy-1beta-methyl-8-methylidene-13-oxo-4a,1alpha-epoxymethano-4aalpha,4bbeta-gibbane-10beta-carboxylic acid
|
|
| CAS | 468-44-0 | |
| PubChem CID | 92109 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 332.4 | ALogp: | 1.7 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 83.8 | Aromatic Rings: | 5 |
| Heavy Atoms: | 24 | QED Weighted: | 0.57 |
| Caco-2 Permeability: | -5.599 | MDCK Permeability: | 0.00001050 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.061 |
| Human Intestinal Absorption (HIA): | 0.025 | 20% Bioavailability (F20%): | 0.792 |
| 30% Bioavailability (F30%): | 0.191 |
| Blood-Brain-Barrier Penetration (BBB): | 0.667 | Plasma Protein Binding (PPB): | 65.46% |
| Volume Distribution (VD): | 0.279 | Fu: | 24.34% |
| CYP1A2-inhibitor: | 0.005 | CYP1A2-substrate: | 0.262 |
| CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.322 |
| CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.249 |
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.159 |
| CYP3A4-inhibitor: | 0.078 | CYP3A4-substrate: | 0.066 |
| Clearance (CL): | 5.452 | Half-life (T1/2): | 0.754 |
| hERG Blockers: | 0.101 | Human Hepatotoxicity (H-HT): | 0.936 |
| Drug-inuced Liver Injury (DILI): | 0.57 | AMES Toxicity: | 0.007 |
| Rat Oral Acute Toxicity: | 0.812 | Maximum Recommended Daily Dose: | 0.795 |
| Skin Sensitization: | 0.247 | Carcinogencity: | 0.148 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.016 |
| Respiratory Toxicity: | 0.963 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002558 | ![]() |
0.654 | D04VIS | ![]() |
0.288 | ||
| ENC002555 | ![]() |
0.605 | D0I1LH | ![]() |
0.278 | ||
| ENC002542 | ![]() |
0.595 | D0KR5B | ![]() |
0.269 | ||
| ENC002554 | ![]() |
0.553 | D03XOC | ![]() |
0.267 | ||
| ENC000143 | ![]() |
0.441 | D04SFH | ![]() |
0.264 | ||
| ENC002556 | ![]() |
0.440 | D0R7JT | ![]() |
0.264 | ||
| ENC002559 | ![]() |
0.426 | D0D1SG | ![]() |
0.257 | ||
| ENC002541 | ![]() |
0.404 | D00YWP | ![]() |
0.255 | ||
| ENC001071 | ![]() |
0.343 | D0CZ1Q | ![]() |
0.252 | ||
| ENC003145 | ![]() |
0.326 | D06XMU | ![]() |
0.250 | ||