|
Name |
Acoradiene
|
| Molecular Formula | C15H24 | |
| IUPAC Name* |
(1R,4S,5S)-1,8-dimethyl-4-prop-1-en-2-ylspiro[4.5]dec-8-ene
|
|
| SMILES |
C[C@@H]1CC[C@H]([C@]12CCC(=CC2)C)C(=C)C
|
|
| InChI |
InChI=1S/C15H24/c1-11(2)14-6-5-13(4)15(14)9-7-12(3)8-10-15/h7,13-14H,1,5-6,8-10H2,2-4H3/t13-,14+,15-/m1/s1
|
|
| InChIKey |
DVBSKQAFCDJNSL-QLFBSQMISA-N
|
|
| Synonyms |
Acoradiene; 24048-44-0; (1R,4S,5S)-1,8-dimethyl-4-prop-1-en-2-ylspiro[4.5]dec-8-ene; DTXSID60946894; 1,8-Dimethyl-4-(1-methylethenyl)-spiro(4,5)dec-7-ene (1R-(1alpha,4beta,5beta))-; Spiro(4,5)dec-7-ene, 1,8-dimethyl-4-(1-methylethenyl)-, (1R-(1alpha,4beta,5beta))-; 1,8-DIMETHYL-4-(PROP-1-EN-2-YL)SPIRO[4.5]DEC-7-ENE
|
|
| CAS | 24048-44-0 | |
| PubChem CID | 90351 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 204.35 | ALogp: | 5.1 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 15 | QED Weighted: | 0.518 |
| Caco-2 Permeability: | -4.441 | MDCK Permeability: | 0.00001580 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.975 |
| 30% Bioavailability (F30%): | 0.951 |
| Blood-Brain-Barrier Penetration (BBB): | 0.106 | Plasma Protein Binding (PPB): | 95.19% |
| Volume Distribution (VD): | 4.02 | Fu: | 4.57% |
| CYP1A2-inhibitor: | 0.847 | CYP1A2-substrate: | 0.208 |
| CYP2C19-inhibitor: | 0.459 | CYP2C19-substrate: | 0.865 |
| CYP2C9-inhibitor: | 0.21 | CYP2C9-substrate: | 0.419 |
| CYP2D6-inhibitor: | 0.061 | CYP2D6-substrate: | 0.493 |
| CYP3A4-inhibitor: | 0.752 | CYP3A4-substrate: | 0.268 |
| Clearance (CL): | 16.941 | Half-life (T1/2): | 0.088 |
| hERG Blockers: | 0.06 | Human Hepatotoxicity (H-HT): | 0.432 |
| Drug-inuced Liver Injury (DILI): | 0.297 | AMES Toxicity: | 0.005 |
| Rat Oral Acute Toxicity: | 0.101 | Maximum Recommended Daily Dose: | 0.244 |
| Skin Sensitization: | 0.808 | Carcinogencity: | 0.75 |
| Eye Corrosion: | 0.934 | Eye Irritation: | 0.931 |
| Respiratory Toxicity: | 0.251 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002392 | ![]() |
1.000 | D04SFH | ![]() |
0.253 | ||
| ENC003255 | ![]() |
0.519 | D0F1UL | ![]() |
0.250 | ||
| ENC002990 | ![]() |
0.519 | D0B4RU | ![]() |
0.250 | ||
| ENC001813 | ![]() |
0.464 | D07BSQ | ![]() |
0.250 | ||
| ENC001832 | ![]() |
0.414 | D04GJN | ![]() |
0.225 | ||
| ENC005089 | ![]() |
0.410 | D0I2SD | ![]() |
0.225 | ||
| ENC001831 | ![]() |
0.390 | D02CJX | ![]() |
0.221 | ||
| ENC001829 | ![]() |
0.390 | D02CNR | ![]() |
0.216 | ||
| ENC003109 | ![]() |
0.390 | D0A2AJ | ![]() |
0.213 | ||
| ENC000555 | ![]() |
0.388 | D0V2JK | ![]() |
0.211 | ||