![]() |
Name |
alpha-Bergamotene
|
Molecular Formula | C15H24 | |
IUPAC Name* |
2,6-dimethyl-6-(4-methylpent-3-enyl)bicyclo[3.1.1]hept-2-ene
|
|
SMILES |
CC1=CCC2CC1C2(C)CCC=C(C)C
|
|
InChI |
InChI=1S/C15H24/c1-11(2)6-5-9-15(4)13-8-7-12(3)14(15)10-13/h6-7,13-14H,5,8-10H2,1-4H3
|
|
InChIKey |
YMBFCQPIMVLNIU-UHFFFAOYSA-N
|
|
Synonyms |
alpha-Bergamotene; 17699-05-7; 2,6-Dimethyl-6-(4-methyl-3-pentenyl)bicyclo[3.1.1]hept-2-ene; alpha-trans-Bergamotene; Bicyclo[3.1.1]hept-2-ene, 2,6-dimethyl-6-(4-methyl-3-pentenyl)-; 2,6-dimethyl-6-(4-methylpent-3-en-1-yl)bicyclo[3.1.1]hept-2-ene; 2-Norpinene, 2,6-dimethyl-6-(4-methyl-3-pentenyl)-; 2,6-dimethyl-6-(4-methylpent-3-enyl)bicyclo[3.1.1]hept-2-ene; Bicyclo(3.1.1)hept-2-ene, 2,6-dimethyl-6-(4-methyl-3-pentenyl)-; .alpha.-trans-Bergamotene; 2,6-Dimethyl-6-(4-methyl-3-pentenyl)bicyclo(3.1.1)hept-2-ene; EINECS 241-702-9; .alpha.-Bergamotene; 2-Norpinene, 2,6-dimethyl-6-(4-methyl-3-pentenyl); ALPHA-BERGAM0TENE; CHEBI:62755; DTXSID90864411; FT-0622209; C17088; Q27132146; 2,6-Dimethyl-6-(4-methyl-3-pentenyl)bicyclo[3.1.1]hept-2-ene #; (E)-2,6-Dimethyl-6-[4-methyl-3-pentenyl]bicyclo[3.1.1]hepta-2-ene; (Z)-2,6-Dimethyl-6-[4-methyl-3-pentenyl]bicyclo[3.1.1]hepta-2-ene; 2,6-Dimethyl-6-(4-methyl-3-penten-1-yl)bicyclo[3.1.1]hept-2-ene
|
|
CAS | 17699-05-7 | |
PubChem CID | 86608 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 4.8 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 15 | QED Weighted: | 0.557 |
Caco-2 Permeability: | -4.397 | MDCK Permeability: | 0.00001170 |
Pgp-inhibitor: | 0.034 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.869 |
30% Bioavailability (F30%): | 0.913 |
Blood-Brain-Barrier Penetration (BBB): | 0.522 | Plasma Protein Binding (PPB): | 96.06% |
Volume Distribution (VD): | 4.388 | Fu: | 3.34% |
CYP1A2-inhibitor: | 0.672 | CYP1A2-substrate: | 0.423 |
CYP2C19-inhibitor: | 0.403 | CYP2C19-substrate: | 0.868 |
CYP2C9-inhibitor: | 0.402 | CYP2C9-substrate: | 0.704 |
CYP2D6-inhibitor: | 0.031 | CYP2D6-substrate: | 0.534 |
CYP3A4-inhibitor: | 0.254 | CYP3A4-substrate: | 0.24 |
Clearance (CL): | 20.214 | Half-life (T1/2): | 0.064 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.732 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.082 |
Skin Sensitization: | 0.565 | Carcinogencity: | 0.102 |
Eye Corrosion: | 0.502 | Eye Irritation: | 0.949 |
Respiratory Toxicity: | 0.147 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001827 | ![]() |
1.000 | D0M1PQ | ![]() |
0.288 | ||
ENC000153 | ![]() |
0.478 | D0W6DG | ![]() |
0.253 | ||
ENC002844 | ![]() |
0.464 | D03VFL | ![]() |
0.240 | ||
ENC002301 | ![]() |
0.381 | D0X7XG | ![]() |
0.207 | ||
ENC001455 | ![]() |
0.377 | D0V8HA | ![]() |
0.197 | ||
ENC001981 | ![]() |
0.367 | D0S7WX | ![]() |
0.195 | ||
ENC000830 | ![]() |
0.367 | D05XQE | ![]() |
0.174 | ||
ENC001484 | ![]() |
0.344 | D0E9KA | ![]() |
0.171 | ||
ENC003799 | ![]() |
0.341 | D0A2AJ | ![]() |
0.167 | ||
ENC001812 | ![]() |
0.333 | D0P1FO | ![]() |
0.167 |