|
Name |
Octyl palmitate
|
| Molecular Formula | C24H48O2 | |
| IUPAC Name* |
octyl hexadecanoate
|
|
| SMILES |
CCCCCCCCCCCCCCCC(=O)OCCCCCCCC
|
|
| InChI |
InChI=1S/C24H48O2/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-22-24(25)26-23-21-19-10-8-6-4-2/h3-23H2,1-2H3
|
|
| InChIKey |
OQILCOQZDHPEAZ-UHFFFAOYSA-N
|
|
| Synonyms |
Octyl palmitate; octyl hexadecanoate; Hexadecanoic acid, octyl ester; 16958-85-3; UYY8LE6Q5Y; Palmitic acid, octyl ester; octyl hexadecanoyl; EINECS 241-028-5; PELEMOL OP; AI3-30712; UNII-UYY8LE6Q5Y; N-OCTYL HEXADECANOATE; SCHEMBL15929; DTXSID8066137; CHEBI:84059; Hexadecanoic acid, n.-octyl ester; Q27157436
|
|
| CAS | 16958-85-3 | |
| PubChem CID | 85651 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 368.6 | ALogp: | 10.9 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 22 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 26 | QED Weighted: | 0.14 |
| Caco-2 Permeability: | -5.007 | MDCK Permeability: | 0.00000927 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.78 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.03 | Plasma Protein Binding (PPB): | 96.99% |
| Volume Distribution (VD): | 3.053 | Fu: | 1.32% |
| CYP1A2-inhibitor: | 0.116 | CYP1A2-substrate: | 0.16 |
| CYP2C19-inhibitor: | 0.256 | CYP2C19-substrate: | 0.053 |
| CYP2C9-inhibitor: | 0.078 | CYP2C9-substrate: | 0.943 |
| CYP2D6-inhibitor: | 0.264 | CYP2D6-substrate: | 0.024 |
| CYP3A4-inhibitor: | 0.261 | CYP3A4-substrate: | 0.034 |
| Clearance (CL): | 5.128 | Half-life (T1/2): | 0.087 |
| hERG Blockers: | 0.477 | Human Hepatotoxicity (H-HT): | 0.008 |
| Drug-inuced Liver Injury (DILI): | 0.301 | AMES Toxicity: | 0.004 |
| Rat Oral Acute Toxicity: | 0.022 | Maximum Recommended Daily Dose: | 0.011 |
| Skin Sensitization: | 0.968 | Carcinogencity: | 0.04 |
| Eye Corrosion: | 0.959 | Eye Irritation: | 0.945 |
| Respiratory Toxicity: | 0.821 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001218 | ![]() |
0.880 | D00AOJ | ![]() |
0.651 | ||
| ENC001234 | ![]() |
0.776 | D07ILQ | ![]() |
0.552 | ||
| ENC000464 | ![]() |
0.771 | D00FGR | ![]() |
0.515 | ||
| ENC000258 | ![]() |
0.769 | D0Z5SM | ![]() |
0.483 | ||
| ENC000430 | ![]() |
0.766 | D00STJ | ![]() |
0.477 | ||
| ENC000474 | ![]() |
0.763 | D00MLW | ![]() |
0.445 | ||
| ENC001243 | ![]() |
0.763 | D0O1PH | ![]() |
0.424 | ||
| ENC000432 | ![]() |
0.759 | D05ATI | ![]() |
0.419 | ||
| ENC000442 | ![]() |
0.753 | D0T9TJ | ![]() |
0.395 | ||
| ENC000285 | ![]() |
0.750 | D0Z1QC | ![]() |
0.384 | ||