|
Name |
trans-Piperitol
|
| Molecular Formula | C10H18O | |
| IUPAC Name* |
(1R,6R)-3-methyl-6-propan-2-ylcyclohex-2-en-1-ol
|
|
| SMILES |
CC1=C[C@@H]([C@H](CC1)C(C)C)O
|
|
| InChI |
InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h6-7,9-11H,4-5H2,1-3H3/t9-,10+/m1/s1
|
|
| InChIKey |
HPOHAUWWDDPHRS-ZJUUUORDSA-N
|
|
| Synonyms |
trans-Piperitol; (3R,4R)-Piperitol; (+)-trans-Piperitenol; p-Menth-1-en-3-ol, trans-; 16721-39-4; BLT1PGO03M; trans-6-(Isopropyl)-3-methylcyclohex-2-en-1-ol; 2-Cyclohexen-1-ol, 3-methyl-6-(1-methylethyl)-, (1R,6R)-rel-; trans-p-Menth-1-en-3-ol; (1R,6R)-6-Isopropyl-3-methyl-cyclohex-2-en-1-ol; F3D9SL651T; E-Piperitol; 2-Cyclohexen-1-ol, 3-methyl-6-(1-methylethyl)-, trans-; p-Menth-1-en-3-ol, trans-(+/-)-; 2-Cyclohexen-1-ol, 3-methyl-6-(1-methylethyl)-, (1R,6R)-; 2-Cyclohexen-1-ol, 3-methyl-6-(1-methylethyl)-, (1R-trans)-; 65733-28-0; Piperitol, trans-; (+-)-trans-Piperitol; UNII-F3D9SL651T; p-Menth-1-en-3-ol, trans-(+-)-; FEMA No. 3179, trans-(+-)-; 6-Isopropyl-3-methyl-2-cyclohexen-1-ol, (E)-; 2-cyclohexen-1-ol, 3-methyl-6-(1-methylethyl)-,(1r,6r)-rel-; UNII-BLT1PGO03M; (1R,6R)-6-Isopropyl-3-methylcyclohex-2-enol, rel-; CHEBI:60; (+)-TRANS-PIPERITOL; (1R,6R)-3-methyl-6-propan-2-ylcyclohex-2-en-1-ol; (+/-)-TRANS-PIPERITOL; DTXSID50884933; EINECS 240-777-5; FEMA NO. 3179, TRANS-(+)-; P-MENTH-1-EN-3-OL, TRANS-(+)-; FEMA NO. 3179, TRANS-(+/-)-; C03039; (1r)-trans-6-isopropyl-3-methyl-cyclohex-2-enol; Q27105215
|
|
| CAS | 16721-39-4 | |
| PubChem CID | 85568 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 154.25 | ALogp: | 2.1 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
| Heavy Atoms: | 11 | QED Weighted: | 0.575 |
| Caco-2 Permeability: | -4.332 | MDCK Permeability: | 0.00001850 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.5 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.238 |
| 30% Bioavailability (F30%): | 0.027 |
| Blood-Brain-Barrier Penetration (BBB): | 0.34 | Plasma Protein Binding (PPB): | 94.27% |
| Volume Distribution (VD): | 1.228 | Fu: | 5.20% |
| CYP1A2-inhibitor: | 0.371 | CYP1A2-substrate: | 0.602 |
| CYP2C19-inhibitor: | 0.04 | CYP2C19-substrate: | 0.917 |
| CYP2C9-inhibitor: | 0.124 | CYP2C9-substrate: | 0.868 |
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.13 |
| CYP3A4-inhibitor: | 0.024 | CYP3A4-substrate: | 0.376 |
| Clearance (CL): | 7.918 | Half-life (T1/2): | 0.667 |
| hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.348 |
| Drug-inuced Liver Injury (DILI): | 0.268 | AMES Toxicity: | 0.01 |
| Rat Oral Acute Toxicity: | 0.034 | Maximum Recommended Daily Dose: | 0.016 |
| Skin Sensitization: | 0.075 | Carcinogencity: | 0.041 |
| Eye Corrosion: | 0.232 | Eye Irritation: | 0.967 |
| Respiratory Toxicity: | 0.05 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000762 | ![]() |
1.000 | D04CSZ | ![]() |
0.381 | ||
| ENC000800 | ![]() |
0.489 | D0O1UZ | ![]() |
0.227 | ||
| ENC002017 | ![]() |
0.469 | D0P1FO | ![]() |
0.224 | ||
| ENC002224 | ![]() |
0.458 | D06GIP | ![]() |
0.208 | ||
| ENC000339 | ![]() |
0.458 | D0P4MT | ![]() |
0.183 | ||
| ENC000165 | ![]() |
0.415 | D06PSS | ![]() |
0.177 | ||
| ENC003093 | ![]() |
0.385 | D0R2KF | ![]() |
0.176 | ||
| ENC004025 | ![]() |
0.385 | D0S0AS | ![]() |
0.171 | ||
| ENC004312 | ![]() |
0.382 | D06PTA | ![]() |
0.171 | ||
| ENC000950 | ![]() |
0.381 | D04GJN | ![]() |
0.169 | ||