![]() |
Name |
2,4-Dimethylheptane
|
Molecular Formula | C9H20 | |
IUPAC Name* |
2,4-dimethylheptane
|
|
SMILES |
CCCC(C)CC(C)C
|
|
InChI |
InChI=1S/C9H20/c1-5-6-9(4)7-8(2)3/h8-9H,5-7H2,1-4H3
|
|
InChIKey |
AUKVIBNBLXQNIZ-UHFFFAOYSA-N
|
|
Synonyms |
2,4-DIMETHYLHEPTANE; 2213-23-2; Heptane, 2,4-dimethyl-; 2,4-DIMETHYL HEPTANE; 2,4-dimethylheptane'; AUKVIBNBLXQNIZ-UHFFFAOYSA-; AMY6077; DTXSID10862873; CHEBI:141558; CAA21323; LMFA11000612; MFCD00048738; AKOS028110008; CS-W004343; LS-13715; D1204; FT-0694447; F17729; Q2813779
|
|
CAS | 2213-23-2 | |
PubChem CID | 16656 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 128.25 | ALogp: | 4.5 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 9 | QED Weighted: | 0.532 |
Caco-2 Permeability: | -4.238 | MDCK Permeability: | 0.00002100 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.205 |
30% Bioavailability (F30%): | 0.798 |
Blood-Brain-Barrier Penetration (BBB): | 0.888 | Plasma Protein Binding (PPB): | 94.69% |
Volume Distribution (VD): | 2.267 | Fu: | 5.07% |
CYP1A2-inhibitor: | 0.934 | CYP1A2-substrate: | 0.661 |
CYP2C19-inhibitor: | 0.456 | CYP2C19-substrate: | 0.886 |
CYP2C9-inhibitor: | 0.642 | CYP2C9-substrate: | 0.893 |
CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.09 |
CYP3A4-inhibitor: | 0.047 | CYP3A4-substrate: | 0.19 |
Clearance (CL): | 10.671 | Half-life (T1/2): | 0.31 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.023 |
Drug-inuced Liver Injury (DILI): | 0.122 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.039 | Maximum Recommended Daily Dose: | 0.022 |
Skin Sensitization: | 0.393 | Carcinogencity: | 0.062 |
Eye Corrosion: | 0.988 | Eye Irritation: | 0.988 |
Respiratory Toxicity: | 0.197 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005689 | ![]() |
1.000 | D00WUF | ![]() |
0.308 | ||
ENC001144 | ![]() |
0.618 | D0Y3KG | ![]() |
0.256 | ||
ENC001207 | ![]() |
0.583 | D0F0YZ | ![]() |
0.226 | ||
ENC000583 | ![]() |
0.568 | D00MYT | ![]() |
0.226 | ||
ENC001199 | ![]() |
0.543 | D0R6BR | ![]() |
0.226 | ||
ENC001174 | ![]() |
0.528 | D0M1PQ | ![]() |
0.225 | ||
ENC001156 | ![]() |
0.525 | D0B2OT | ![]() |
0.220 | ||
ENC000581 | ![]() |
0.486 | D05PLH | ![]() |
0.207 | ||
ENC000503 | ![]() |
0.485 | D03LGY | ![]() |
0.206 | ||
ENC001158 | ![]() |
0.462 | D0ZK8H | ![]() |
0.194 |