![]() |
Name |
2-Methylnonane
|
Molecular Formula | C10H22 | |
IUPAC Name* |
2-methylnonane
|
|
SMILES |
CCCCCCCC(C)C
|
|
InChI |
InChI=1S/C10H22/c1-4-5-6-7-8-9-10(2)3/h10H,4-9H2,1-3H3
|
|
InChIKey |
SGVYKUFIHHTIFL-UHFFFAOYSA-N
|
|
Synonyms |
2-METHYLNONANE; 871-83-0; Nonane, 2-methyl-; 2 - methylnonane; Octane, dimethyl-; 68551-16-6; 382AKH052V; NSC-24849; ISODECANE; C9-11 Isoparaffin; 63335-88-6; EINECS 271-365-3; iso-decane; UNII-382AKH052V; 34464-38-5; 2-methyl nonane; 2-methyl-nonane; EINECS 212-814-5; EINECS 252-052-0; NSC 24849; C10-13 Isoparaffin; UNII-UQ7SPY0IRF; UQ7SPY0IRF; METHYLNONANE, 2-; DTXSID80873239; NSC24849; ZINC1615328; EINECS 271-366-9; BBL103998; LMFA11000615; MFCD00027321; STL557809; 2-Methylnonane, >=99.0% (GC); AKOS015841666; LS-13906; DB-056979; FT-0633043; M0281; D91304; Q2813818
|
|
CAS | 871-83-0 | |
PubChem CID | 13379 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 142.28 | ALogp: | 5.3 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 10 | QED Weighted: | 0.474 |
Caco-2 Permeability: | -4.277 | MDCK Permeability: | 0.00001350 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.656 |
30% Bioavailability (F30%): | 0.971 |
Blood-Brain-Barrier Penetration (BBB): | 0.776 | Plasma Protein Binding (PPB): | 97.01% |
Volume Distribution (VD): | 2.594 | Fu: | 2.84% |
CYP1A2-inhibitor: | 0.909 | CYP1A2-substrate: | 0.462 |
CYP2C19-inhibitor: | 0.583 | CYP2C19-substrate: | 0.734 |
CYP2C9-inhibitor: | 0.494 | CYP2C9-substrate: | 0.937 |
CYP2D6-inhibitor: | 0.024 | CYP2D6-substrate: | 0.067 |
CYP3A4-inhibitor: | 0.082 | CYP3A4-substrate: | 0.136 |
Clearance (CL): | 6.633 | Half-life (T1/2): | 0.207 |
hERG Blockers: | 0.046 | Human Hepatotoxicity (H-HT): | 0.015 |
Drug-inuced Liver Injury (DILI): | 0.149 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.053 | Maximum Recommended Daily Dose: | 0.028 |
Skin Sensitization: | 0.693 | Carcinogencity: | 0.06 |
Eye Corrosion: | 0.992 | Eye Irritation: | 0.982 |
Respiratory Toxicity: | 0.4 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000558 | ![]() |
0.818 | D05ATI | ![]() |
0.298 | ||
ENC000490 | ![]() |
0.750 | D01QLH | ![]() |
0.289 | ||
ENC000420 | ![]() |
0.688 | D0AY9Q | ![]() |
0.278 | ||
ENC000797 | ![]() |
0.676 | D0G2KD | ![]() |
0.271 | ||
ENC000583 | ![]() |
0.676 | D02MLW | ![]() |
0.269 | ||
ENC001144 | ![]() |
0.639 | D0Z5SM | ![]() |
0.266 | ||
ENC001120 | ![]() |
0.639 | D0I4DQ | ![]() |
0.263 | ||
ENC000554 | ![]() |
0.636 | D05QNO | ![]() |
0.250 | ||
ENC001156 | ![]() |
0.625 | D0D9NY | ![]() |
0.250 | ||
ENC001148 | ![]() |
0.622 | D0H2YX | ![]() |
0.250 |