![]() |
Name |
Pinonic acid
|
Molecular Formula | C10H16O3 | |
IUPAC Name* |
2-(3-acetyl-2,2-dimethylcyclobutyl)acetic acid
|
|
SMILES |
CC(=O)C1CC(C1(C)C)CC(=O)O
|
|
InChI |
InChI=1S/C10H16O3/c1-6(11)8-4-7(5-9(12)13)10(8,2)3/h7-8H,4-5H2,1-3H3,(H,12,13)
|
|
InChIKey |
SIZDUQQDBXJXLQ-UHFFFAOYSA-N
|
|
Synonyms |
Pinonic acid; 473-72-3; 2-(3-acetyl-2,2-dimethylcyclobutyl)acetic acid; 61826-55-9; cis-Pinonic acid; Cyclobutaneacetic acid, 3-acetyl-2,2-dimethyl-; NSC29469; NSC609391; NSC 29469; Cyclobutaneacetic acid,2-dimethyl-; cis-3-Acetyl-2,2-dimethylcyclobutylacetic acid; EINECS 207-471-3; AI3-19190; 3-ACETYL-2,2-DIMETHYLCYCLOBUTANEACETIC ACID; (+) Pinonic acid; (+)-Pinonic acid; SCHEMBL611079; DTXSID60874123; NSC46248; NSC96748; NSC 45643; NSC-29469; NSC-46248; NSC-96748; AKOS004120644; NSC-609391; SB45648; CS-0345782; EN300-296222; (3-acetyl-2,2-dimethyl-cyclobutyl)-acetic acid
|
|
CAS | 473-72-3 | |
PubChem CID | 10130 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 184.23 | ALogp: | 1.0 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 54.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.732 |
Caco-2 Permeability: | -5.002 | MDCK Permeability: | 0.00008630 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.395 | Plasma Protein Binding (PPB): | 49.70% |
Volume Distribution (VD): | 0.2 | Fu: | 51.43% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.107 |
CYP2C19-inhibitor: | 0.011 | CYP2C19-substrate: | 0.287 |
CYP2C9-inhibitor: | 0.02 | CYP2C9-substrate: | 0.981 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.312 |
CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.137 |
Clearance (CL): | 13.93 | Half-life (T1/2): | 0.71 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.12 |
Drug-inuced Liver Injury (DILI): | 0.035 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.141 |
Skin Sensitization: | 0.173 | Carcinogencity: | 0.051 |
Eye Corrosion: | 0.993 | Eye Irritation: | 0.983 |
Respiratory Toxicity: | 0.722 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001350 | ![]() |
0.322 | D0G4JI | ![]() |
0.278 | ||
ENC005521 | ![]() |
0.319 | D06XGW | ![]() |
0.234 | ||
ENC005547 | ![]() |
0.313 | D0A8CJ | ![]() |
0.234 | ||
ENC002902 | ![]() |
0.313 | D06VNK | ![]() |
0.233 | ||
ENC003143 | ![]() |
0.303 | D02KJX | ![]() |
0.233 | ||
ENC003152 | ![]() |
0.291 | D04SFH | ![]() |
0.232 | ||
ENC000061 | ![]() |
0.278 | D00VZZ | ![]() |
0.228 | ||
ENC000830 | ![]() |
0.276 | D0P2IW | ![]() |
0.224 | ||
ENC004124 | ![]() |
0.273 | D0Z4NI | ![]() |
0.220 | ||
ENC001166 | ![]() |
0.273 | D0F1GS | ![]() |
0.220 |