|
Name |
Mesityl oxide
|
| Molecular Formula | C6H10O | |
| IUPAC Name* |
4-methylpent-3-en-2-one
|
|
| SMILES |
CC(=CC(=O)C)C
|
|
| InChI |
InChI=1S/C6H10O/c1-5(2)4-6(3)7/h4H,1-3H3
|
|
| InChIKey |
SHOJXDKTYKFBRD-UHFFFAOYSA-N
|
|
| Synonyms |
MESITYL OXIDE; 4-Methylpent-3-en-2-one; 141-79-7; 4-Methyl-3-penten-2-one; 3-Penten-2-one, 4-methyl-; Methyl isobutenyl ketone; Isopropylideneacetone; Isobutenyl methyl ketone; Mesityloxid; Mesityloxyde; Ossido di mesitile; 3-Isohexen-2-one; Isopropylidene acetone; Oxyde de mesityle; Acetone, isopropylidene-; Methyl 2-methyl-1-propenyl ketone; Methyl 2,2-dimethylvinyl ketone; 2-Methyl-4-oxo-2-pentene; 2-Methyl-2-pentenone-4; 2,2-Dimethylvinyl methyl ketone; 4-Metil-3-penten-2-one; 4-Methyl-3-pentene-2-one; 4-Methyl-3-penten-2-on; 2-Methyl-2-penten-4-one; FEMA No. 3368; NSC 38717; 4-Methyl-3-penten-2-one, 9CI; 4-methyl-pent-3-en-2-one; CHEBI:89993; (CH3)2C=CHC(=O)CH3; NSC-38717; 77LAC84669; DSSTox_CID_9170; DSSTox_RID_78697; DSSTox_GSID_29170; Mesityloxid [German]; Mesityloxyde [Dutch]; Caswell No. 547; FEMA Number 3368; Oxyde de mesityle [French]; CAS-141-79-7; Ossido di mesitile [Italian]; HSDB 1195; EINECS 205-502-5; 4-Metil-3-penten-2-one [Italian]; UN1229; EPA Pesticide Chemical Code 052401; BRN 1361550; 4-Methyl-3-penten-2-on [Dutch, German]; AI3-07702; UNII-77LAC84669; Mesityloxid(german); MFCD00008900; Isopropylidene-Acetone; Mesityl oxide [UN1229] [Flammable liquid]; EC 205-502-5; 2-methylpent-2-en-4-one; MESITYL OXIDE [MI]; 1-Methylpent-2-en-4-one; MESITYL OXIDE [HSDB]; CHEMBL3185916; DTXSID1029170; FEMA 3368; WLN: 1Y1 & U1V1; 4-Methyl-3-penten-2-one, 90%; AMY23356; NSC38717; Tox21_202080; Tox21_303606; LMFA12000030; STL146350; Mesityl oxide, technical grade, 90%; AKOS000118892; ZINC100019800; UN 1229; NCGC00249161-01; NCGC00257514-01; NCGC00259629-01; 4-Methyl-3-penten-2-one (mesityl oxide); 4-Methyl-3-penten-2-on(DUTCH, GERMAN); 4-METHYL-3-PENTENE-2-ONE [FHFI]; FT-0628235; M0069; M1340; TEICOPLANIN IMPURITY A [EP IMPURITY]; 3-PENTEN,2-ONE,4-METHYL MESITYLOXIDE; EN300-21333; Mesityl oxide [UN1229] [Flammable liquid]; 3-PENTEN,2-ONE,4-METHYL MESITYLOXIDE; A807813; CILASTATIN SODIUM IMPURITY D [EP IMPURITY]; Q425668; Q-201356; 4-Methyl-3-penten-2-one, analytical reference material; Mesityl oxide, 90%, remainder 4-methyl-4-penten-2-one; Mesityl oxide, European Pharmacopoeia (EP) Reference Standard; Mesityl Oxide, Pharmaceutical Secondary Standard; Certified Reference Material; Mesityl oxide, suitable for neutral marker for measuring electroosmotic flow (EOF), ~98%
|
|
| CAS | 141-79-7 | |
| PubChem CID | 8858 | |
| ChEMBL ID | CHEMBL3185916 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 98.14 | ALogp: | 1.4 |
| HBD: | 0 | HBA: | 1 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
| Heavy Atoms: | 7 | QED Weighted: | 0.459 |
| Caco-2 Permeability: | -4.293 | MDCK Permeability: | 0.00002730 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.007 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.09 |
| 30% Bioavailability (F30%): | 0.013 |
| Blood-Brain-Barrier Penetration (BBB): | 0.984 | Plasma Protein Binding (PPB): | 60.12% |
| Volume Distribution (VD): | 1.518 | Fu: | 56.54% |
| CYP1A2-inhibitor: | 0.496 | CYP1A2-substrate: | 0.557 |
| CYP2C19-inhibitor: | 0.273 | CYP2C19-substrate: | 0.873 |
| CYP2C9-inhibitor: | 0.046 | CYP2C9-substrate: | 0.241 |
| CYP2D6-inhibitor: | 0.024 | CYP2D6-substrate: | 0.434 |
| CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.419 |
| Clearance (CL): | 7.976 | Half-life (T1/2): | 0.851 |
| hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.134 |
| Drug-inuced Liver Injury (DILI): | 0.078 | AMES Toxicity: | 0.025 |
| Rat Oral Acute Toxicity: | 0.038 | Maximum Recommended Daily Dose: | 0.343 |
| Skin Sensitization: | 0.922 | Carcinogencity: | 0.79 |
| Eye Corrosion: | 0.994 | Eye Irritation: | 0.988 |
| Respiratory Toxicity: | 0.479 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001727 | ![]() |
0.414 | D0F1GS | ![]() |
0.308 | ||
| ENC001719 | ![]() |
0.342 | D0Z4NI | ![]() |
0.308 | ||
| ENC001720 | ![]() |
0.342 | D0G4JI | ![]() |
0.250 | ||
| ENC001701 | ![]() |
0.333 | D04CRL | ![]() |
0.250 | ||
| ENC001434 | ![]() |
0.314 | D0Z4UY | ![]() |
0.238 | ||
| ENC001424 | ![]() |
0.314 | D0C1PY | ![]() |
0.238 | ||
| ENC005488 | ![]() |
0.308 | D0ZK8H | ![]() |
0.233 | ||
| ENC000418 | ![]() |
0.308 | D0M1PQ | ![]() |
0.229 | ||
| ENC000879 | ![]() |
0.308 | D0FM2P | ![]() |
0.219 | ||
| ENC000532 | ![]() |
0.308 | D0R9BG | ![]() |
0.217 | ||